The polynomial 2x³-9x2+kx+21 with factor (2x-1) has the value of k as -38.
To find the value of k, we need to use the factor theorem. The factor theorem states that if (2x-1) is a factor of a polynomial, then substituting the root of that factor into the polynomial will result in zero.
In this case, the factor is (2x-1), so we can set 2x-1 equal to zero and solve for x:
2x-1 = 0
Adding 1 to both sides, we get:
2x = 1
Dividing both sides by 2, we find:
x = 1/2
Now, substitute x = 1/2 into the polynomial:
2(1/2)³ - 9(1/2)² + k(1/2) + 21 = 0
Simplifying, we have:
1/4 - 9/4 + k/2 + 21 = 0
Combining like terms:
k/2 -2 + 21 = 0
k/2 -19= 0
k/2 =-19
To solve for k, we can multiply both sides by 2:
k=-38
Therefore, the value of k is -38.
Learn more about factor :
https://brainly.com/question/1081523
#SPJ11
Understanding Pop
Active
Pre-Test
2
3
4
5 6
7
8
A dot density map uses dots to show the
O number of people living in a certain area.
Oratio of land to water in a certain area.
O types of resources in a certain area.
O type of climate in a certain area.
9
10
A dot density map uses dots to show the number of people living in a certain area.
A dot density map is a cartographic technique used to represent the number of people living in a specific area. It employs dots to visually depict the population distribution across a region.
The density of dots in a given area corresponds to a higher concentration of people residing there.
This method allows for a quick and intuitive understanding of population patterns and can be used to analyze population distribution, identify densely populated areas, or compare population densities between different regions.
It is important to note that dot density maps specifically focus on representing population and do not convey information regarding the ratio of land to water, types of resources, or climate in an area.
for such more question on density map
https://brainly.com/question/1354972
#SPJ8
Epoxidation/cyclopropanation 2 Unanswered 1 attempt left A species that has opposite charges on adjacent atoms is most often defined as what?
A species that has opposite charges on adjacent atoms is most often defined as an ion or an ionic compound.
A species that has opposite charges on adjacent atoms is typically defined as an ion or an ionic compound due to the presence of ionic bonding. In ionic compounds, atoms with different electronegativities transfer electrons, resulting in the formation of ions with opposite charges. These ions are attracted to each other through electrostatic forces, creating a stable crystal lattice structure. The presence of opposite charges on adjacent atoms is a characteristic feature of ionic compounds and distinguishes them from covalent compounds, where electron pairs are shared between atoms.
To know more about ionic compound,
https://brainly.com/question/30418469
#SPJ11
In the diagram, BCD is a straight line. Angle ACB is a right angle. BC=6cm, tan x= 1.3 and cos y = 0.4 Work out the length of AD.
Answer:
Step-by-step explanation:
12
Bromine monochloride is synthesized using the reaction Br_2(g)+Cl_2(g) --->2BrCl(g) Kp=1.1×10−4 at 150 K A 201.0 L flask initially contains 1.058 kg of Br2 and 1.195 kg of Cl2. Calculate the mass of BrCl , in grams, that is present in the reaction mixture at equilibrium. Assume ideal gas behaviour
The mass of BrCl present in the reaction mixture at equilibrium is 1529.19 grams.
To find the mass of BrCl in the reaction mixture at equilibrium, we need to use the given equilibrium constant (Kp) and the initial amounts of Br2 and Cl2.
First, let's convert the given masses of Br2 and Cl2 into moles using their molar masses.
The molar mass of Br2 is 159.808 g/mol, and the molar mass of Cl2 is 70.906 g/mol.
1.058 kg of Br2 = 1.058 kg × (1000 g / 1 kg) × (1 mol / 159.808 g) = 6.618 mol Br2
1.195 kg of Cl2 = 1.195 kg × (1000 g / 1 kg) × (1 mol / 70.906 g) = 16.830 mol Cl2
According to the balanced equation, the stoichiometry of the reaction is 1:1:2 for Br2, Cl2, and BrCl, respectively.
This means that for every 1 mole of Br2 and Cl2, we get 2 moles of BrCl. Since the initial amounts of Br2 and Cl2 are in excess, the reaction will proceed until one of them is completely consumed.
Let's assume that all of the Br2 is consumed. Since 1 mole of Br2 produces 2 moles of BrCl, the total moles of BrCl produced will be 2 × 6.618 mol = 13.236 mol.
Now, we can convert the moles of BrCl into grams using its molar mass.
The molar mass of BrCl is 115.823 g/mol. Mass of BrCl = 13.236 mol × 115.823 g/mol = 1529.19 g
Therefore, the mass of BrCl present in the reaction mixture at equilibrium is 1529.19 grams.
Note: It is important to ensure that the units are consistent throughout the calculations and to use the correct molar masses and conversion factors.
Learn more about molar mass at
https://brainly.com/question/15937867
#SPJ11
100 poitns
Port Elizabeth, South Africa is about 32° south of the equator and 25° east of the prime
meridian. Perth, Australia is also about 32° south, but 115° east of the prime meridian.
How far apart are Port Elizabeth and Perth?
To determine the distance between Port Elizabeth, South Africa, and Perth, Australia, we can use the Haversine formula, which is commonly used to calculate distances between two points on the Earth's surface given their latitude and longitude coordinates.
Using the Haversine formula, the distance (d) between two points with coordinates (lat1, lon1) and (lat2, lon2) is given by:
d = 2r * arcsin(√(sin²((lat2 - lat1)/2) + cos(lat1) * cos(lat2) * sin²((lon2 - lon1)/2)))
In this case, the latitude and longitude coordinates for Port Elizabeth are approximately (-32°, 25°), and for Perth are approximately (-32°, 115°).
Substituting these values into the formula:
d = 2 * r * arcsin(√(sin²((-32° - (-32°))/2) + cos(-32°) * cos(-32°) * sin²((115° - 25°)/2)))
Note that the angles should be in radians for the trigonometric functions, so we convert the degrees to radians:
d = 2 * r * arcsin(√(sin²((-32° - (-32°))/2) + cos(-32°) * cos(-32°) * sin²((115° - 25°)/2)))
Using the Earth's average radius r ≈ 6,371 kilometers, we can calculate the distance between Port Elizabeth and Perth using the formula above.
Learn more about longitude here
https://brainly.com/question/30340298
#SPJ11
If y varies directly as x, and y is 18 when x is 5, which expression can be used to find the value of y when x is 11? y = StartFraction 5 Over 18 EndFraction (11) y = StartFraction 18 Over 5 EndFraction (11) y = StartFraction (18) (5) Over 11 EndFraction y = StartFraction 11 Over (18) (5) EndFraction
The expression that can be used to find the value of y when x is 11 is y = (18/5)(11). Option B.
When two variables vary directly, it means that they have a constant ratio between them. In this case, if y varies directly as x, we can express this relationship using the equation:
y = kx
where k represents the constant of variation.
To find the value of y when x is 11, we need to determine the value of k first. Given that y is 18 when x is 5, we can substitute these values into the equation:
18 = k(5)
To solve for k, we divide both sides of the equation by 5:
k = 18/5
Now we have the value of k. We can substitute it back into the equation and solve for y when x is 11:
y = (18/5)(11)
Simplifying this expression gives us:
y = 198/5
Therefore, the value of y when x is 11 is 198/5. SO Option B is correct.
FOr more question on expression visit:
https://brainly.com/question/1859113
#SPJ8
In the cementation process, the copper concentration in the pregnant leach liquor which enters the cementation launder contains 20gpl copper and can be reduced to very low levels in the cementation process. The barren liquor leaves the cementation launder at 25°C and contains 0.6gpl of iron, i) Write down the reaction depicting the cementation of copper by iron and calculate the overall cell potential 11) estimate the residual copper content of the barren liquor i.e. remaining copper in the solution after cementation 111) Hence estimate the % copper recovered from solution
1) The reaction depicting the cementation of copper by iron is:
Cu2+(aq) + Fe(s) -> Cu(s) + Fe2+(aq)
2) To calculate the overall cell potential, we need to use the standard reduction potentials of the half-reactions involved. The reduction potential of Cu2+ to Cu is +0.34V, and the reduction potential of Fe2+ to Fe is -0.44V. The overall cell potential can be calculated by subtracting the reduction potential of the anode reaction (Fe2+ to Fe) from the reduction potential of the cathode reaction (Cu2+ to Cu).
Overall cell potential = (+0.34V) - (-0.44V)
= +0.34V + 0.44V
= +0.78V
Therefore, the overall cell potential of the cementation process is +0.78V.
3) To estimate the residual copper content of the barren liquor, we need to calculate the amount of copper that has been removed during the cementation process. Since the initial copper concentration in the pregnant leach liquor is 20gpl and the barren liquor contains 0.6gpl of iron, we can assume that all the iron has reacted with copper to form copper metal. Therefore, the amount of copper removed can be calculated by multiplying the iron concentration by its molar mass (55.85g/mol) and dividing it by the molar mass of copper (63.55g/mol).
Amount of copper removed = (0.6gpl * 55.85g/mol) / 63.55g/mol
= 0.5274gpl
Therefore, the residual copper content in the barren liquor is approximately 20gpl - 0.5274gpl = 19.4726gpl.
4) To estimate the percentage of copper recovered from the solution, we can calculate the percentage of copper removed from the initial concentration of copper in the pregnant leach liquor.
% Copper recovered = (Amount of copper removed / Initial copper concentration) * 100
= (0.5274gpl / 20gpl) * 100
= 2.637%
Therefore, the percentage of copper recovered from the solution is approximately 2.637%.
To know more about cementation of copper :
https://brainly.com/question/32109091
#SPJ11
A 5000− seat theater has tickets for sale at $25 and $40. How many tickets should be sold at each price for a sellout performance to generate a total revenue of $144,500?
The number of tickets for sale at $25 should be The number of lickets for sale at $40 should be
The number of tickets for sale at $25 should be 3700, and the number of tickets for sale at $40 should be 1300 to generate a total revenue of $144,500
To determine the number of tickets that should be sold at each price, we can use a system of equations.
Let's assume that the number of tickets sold at $25 is represented by x, and the number of tickets sold at $40 is represented by y.
We know that the total revenue generated from selling x tickets at $25 and y tickets at $40 should be $144,500. We can express this information as an equation:
25x + 40y = 144,500
Additionally, we know that the total number of tickets sold should be 5000, which gives us another equation:
x + y = 5000
Now we have a system of two equations with two variables:
25x + 40y = 144,500
x + y = 5000
To solve this system, we can use the method of substitution or elimination.
In this case, let's use the method of substitution.
Solving the second equation for x, we get:
x = 5000 - y
Now we can substitute this expression for x in the first equation:
25(5000 - y) + 40y = 144,500
Expanding and simplifying this equation, we have:
125000 - 25y + 40y = 144,500
Combining like terms, we get:
15y = 19500
Dividing both sides by 15, we find:
y = 1300
Now we can substitute this value of y back into the second equation to find x:
x + 1300 = 5000
Subtracting 1300 from both sides, we get:
x = 3700
Therefore, the number of tickets for sale at $25 should be 3700, and the number of tickets for sale at $40 should be 1300 to generate a total revenue of $144,500.
Learn more about total revenue from this link:
https://brainly.com/question/15267519
#SPJ11
Find the series solution of y′′+xy′+x^2y=0
Given differential equation is : [tex]$y''+xy'+x^2y=0$[/tex]To find series solution we assume : $y(x)=\sum_{n=0}^{\infty} a_n x^n$ Differentiate $y(x)$ with respect to x: $y'(x)=\sum_{n=1}^{\infty} na_n x^{n-1}$Differentiate $y'(x)$ with respect to [tex]x: $y''(x)=\sum_{n=2}^{\infty} n(n-1) a_n x^{n-2}$.[/tex]
Substitute $y(x)$, $y'(x)$ and $y''(x)$ in the given differential equation and collect coefficients of $x^n$, then set them to 0:$$\begin[tex]{aligned}n^2 a_n+(n+1)a_{n+1}+a_{n-1}=0\\a_1=0\\a_0=1\end{aligned}$$[/tex]The recurrence relation is : $a_{n+1}=\frac{-1}{n+1} a_{n-1} -\frac{1}{n^2}a_n$.
Now, we will find the first few coefficients of the series expansion using the recurrence relation: [tex]$$\begin{aligned}a_0&=1\\a_1&=0\\a_2&=-\frac{1}{2}\\a_3&=0\\a_4&=\frac{-1}{2\cdot4}\\a_5&=0\\a_6&=\frac{-1}{2\cdot4\cdot6}\\&\quad \vdots\end{aligned}$$[/tex].
The series solution is given by: [tex]$$y(x)=\sum_{n=0}^{\infty} a_n x^n = 1-\frac{1}{2}x^2+\frac{-1}{2\cdot4}x^4+\frac{-1}{2\cdot4\cdot6}x^6+ \cdots$$.[/tex]
Thus, the series solution of $y''+xy'+x^2y=0$ is $y(x)=1-\frac{1}{2}x^2+\frac{-1}{2\cdot4}x^4+\frac{-1}{2\cdot4\cdot6}x^6+ \cdots$ which is in the form of a Maclaurin series.
To know more about differential visit:
https://brainly.com/question/33433874
#SPJ11
The series solution of the differential equation y(x) = a₀ - 1/3x²a₀ + 1/45xa₀ - 2/945x⁶a₀ + ....
What is the power series method?You should knows than the series solution is used to seek a power series solution to certain differential equations.
In general, such a solution assumes a power series with unknown coefficients, then substitutes that solution into the differential equation to find a recurrence relation for the coefficients.
The differential equation y′′+xy′+x²y=0 is a second-order homogeneous differential equation with variable coefficients.
The function y(x) can be expressed as a power series of x
y(x) = ∑(n=0 to ∞) aₙxⁿ
Differentiate y(x)
y′(x) = ∑(n = 1 to ∞) n aₙxⁿ ⁻ ¹
y′′(x) = ∑(n = 2 to ∞) n(n - 1) aₙxⁿ ⁻ ²
By Substituting these expressions into the differential equation
[tex]\sum\limits^{\infty}_2 n(n-1) a_n x^{n-2} + \sum\limits^{\infty}_1 a_n x^n + x^2 \sum\limits^{\infty}_0 a_n x^n = 0[/tex]
By simplifying the expression by shifting the indices of the first sum, we get
[tex]\sum\limits^{\infty}_0 (n+2)(n+1) a_{n+2} x^n + \sum\limits^{\infty}_0 a_n x^n + \sum\limits^{\infty}_0 a_n x^{n+2} = 0[/tex]
Equating the coefficients of like powers of x to zero gives us a recurrence relation for the coefficients aₙ in terms of aₙ₋₂.
y(x) = a₀ - 1/3x²a₀ + 1/45xa₀ - 2/945x⁶a₀ + ...,
where a₀ is an arbitrary constant.
Learn more about power series on https://brainly.com/question/29896893
#SPJ4
Calculate the equilibrium concentration of undissociated CH 3
CHOHCOOH in a lactic acid solution with an analytical lactic acid concentration of 0.0694M and apH of 3.170. K a
(CH 3
CHOHCOOH)=1.38×10 −4
. Concentration = M
The answer is 7.97 × 10^-2.
Given,Analytical lactic acid concentration, c = 0.0694
MpH of the solution, pKa and Ka of CH3CHOCOOH, pKa = - log KaKa
= antilog (- pKa)Ka
= antilog (- 1.138)Ka
= 2.455×10-2M
= [CH3CHOCOOH] + [CH3CHOHCOO]-Ka
= ([CH3CHOHCOO-] [H+]) / [CH3CHOCOOH][CH3CHOHCOO-]
= [H+] x [CH3CHOCOOH] / Ka[CH3CHOHCOO-] = [H+] x 0.0694M / (1.38 × 10^-4)M[CH3CHOHCOO-]
= 4.357 × 10^-1 x H+
Similarly, [CH3CHOCOOH] = (0.0694M - [CH3CHOHCOO-])
= (0.0694M - 4.357 × 10^-1 x H+)
At equilibrium, [CH3CHOHCOOH] = [CH3CHOHCOO-] + [H+][CH3CHOHCOOH]
= 5.357 × 10^-1 x H+ + 0.0694M - 4.357 × 10^-1 x H+[CH3CHOHCOOH]
= 7.97 × 10^-2M + 0.999 × [H+]
Equilibrium concentration of undissociated CH3CHOHCOOH = [CH3CHOHCOOH]
= 7.97 × 10^-2M.
Hence, the answer is 7.97 × 10^-2.
Know more about Analytical lactic acid concentration here:
https://brainly.com/question/14279880
#SPJ11
A marching band begins its performance
in a pyramid formation. The first row has 1 band member,
the second row has 3 band members, the third row has
5 band members, and so on. (Examples 1 and 2)
a. Find the number of band members in the 8th row.
Answer:
15 members in the 8th row
Step-by-step explanation:
To find the number of band members in the 8th row of the pyramid formation, we can observe that the number of band members in each row follows an arithmetic sequence where the common difference is 2.
To find the number of band members in the 8th row, we can use the formula for the nth term of an arithmetic sequence:
nth term = first term + (n - 1) * common difference
In this case, the first term is 1 (the number of band members in the first row), the common difference is 2, and we want to find the 8th term.
Plugging the values into the formula:
8th term = 1 + (8 - 1) * 2
Calculating:
8th term = 1 + 7 * 2
8th term = 1 + 14
8th term = 15
The following precipitation reaction can be used to determine the amount of copper ions dissolved in solution. A chemist added 5.00 x 102 L of a solution containing 0.173 mol L¹ Na3PO4(aq) to a 5.00 x 102 L sample containing CuCl₂(aq). This resulted in a precipitate. The chemist filtered, dried, and weighed the precipitate. If 1.21 g of Cu3(PO4)2(s) were obtained, and assuming no copper ions remained in solution, calculate the following: a. the concentration of Cu²+ (aq) ions in the sample solution. b. the concentrations of Na* (aq), CI (aq), and PO43(aq) in the reaction solution (supernatant) after the precipitate was removed. 5. Calculate the number of moles of gas in a 3.24 L basketball inflated to a total pressure of 25.1 psi at 25°C. What is the total pressure (in psi) of gas in this basketball if the temperature is changed to 0°C? 6. Calculate the density of gas in a 3.24 L basketball inflated with air to a total pressure of 25.1 psi at 25°C. Assume the composition of air is 78% N₂, 21% O2, and 1% Ar. [Ignore all other gases.] 7. A sample of gas has a mass of 0.623 g. Its volume is 2.35 x 10¹ Lata temperature of 53°C and a pressure of 763 torr. Find the molar mass of the gas.
a. To calculate the concentration of Cu²+ ions in the sample solution, we need to use stoichiometry and the amount of [tex]Cu_3(PO_4)_2[/tex] precipitate obtained.
b. The concentrations of Na+, Cl-, and [tex]PO_4[/tex]3- ions in the reaction solution can be determined using the volume and initial concentration of [tex]Na_3PO_4[/tex] and the stoichiometry of the reaction.
5. To calculate the number of moles of gas in the basketball at 25°C and 0°C, we can use the ideal gas law equation and convert the temperature from Celsius to Kelvin.
6. To calculate the density of the gas in the basketball, we need to use the ideal gas law equation and the molar mass of air.
7. To find the molar mass of the gas, we can use the ideal gas law equation, the given mass, volume, temperature, and pressure of the gas, and solve for the molar mass.
a. To calculate the concentration of Cu²+ ions, we need to determine the moles of [tex]Cu_3(PO_4)_2[/tex] precipitate obtained using its mass and molar mass. Then, using the volume of the sample solution, we can calculate the concentration of Cu²+ ions.
b. To determine the concentrations of Na+, Cl-, and [tex]PO_4[/tex]3- ions in the reaction solution, we can use stoichiometry and the initial concentration and volume of [tex]Na_3PO_4[/tex]. Since the reaction is assumed to go to completion, the concentrations of Na+ and Cl- ions will be equal to the initial concentration of [tex]Na_3PO_4[/tex], while the concentration of [tex]PO_4[/tex]3- ions can be calculated using the stoichiometric ratio.
5. To calculate the number of moles of gas at 25°C, we use the ideal gas law equation PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin. We can rearrange the equation to solve for n.
6. To calculate the density of the gas, we divide the mass of the gas by its volume. Since the composition of air is given, we can calculate the molar mass of air using the percentages of the constituent gases and their molar masses.
7. To find the molar mass of the gas, we can rearrange the ideal gas law equation PV = nRT to solve for the molar mass. By substituting the given values of mass, volume, temperature, and pressure, we can solve for the molar mass of the gas.
To know more about Equation visit-
brainly.com/question/14686792
#SPJ11
Point F is the image when point f is reflected over the line x=-2 and then over the line y=3. The location of F is (5, 7). which of the following is the location of point F?
A.) (-5,-7)
B.) (-9.-1)
C.) (-1,-3)
D.) (-1,13)
QUESTIONNAIRE Answer the following: SITUATION 1 A stone weigh 105 lbs in air. When submerged in water, it weighs 67.0 lb. 1. Find the volume of the stone. 2. Find the specific gravity of the stone. 3. A piece of irregularly shaped metal weighs 0.3 kN in air. When the metal is completely submerged in water, it weights 0.2325 kN. Find the volume of the metal.
1. The volume of the stone is approximately 0.39 cubic feet.
2. The specific gravity of the stone is approximately 2.69.
3. The volume of the metal is approximately 0.017 cubic meters.
When an object is submerged in a fluid, such as water, it experiences a buoyant force that counteracts the force of gravity. By measuring the change in weight of the object when submerged, we can determine its volume and specific gravity.
1) In the first situation, we are given that the stone weighs 105 lbs in air and 67.0 lbs when submerged in water. The difference between these two weights represents the buoyant force acting on the stone. By applying Archimedes' principle, we can equate the weight of the displaced water to the buoyant force.
To find the volume of the stone, we divide the weight difference by the density of water. The density of water is approximately 62.4 lbs/ft³. Therefore, the volume of the stone is calculated as (105 lbs - 67.0 lbs) / (62.4 lbs/ft³) ≈ 0.39 ft³.
2) Next, to determine the specific gravity of the stone, we compare its density to the density of water. The specific gravity is the ratio of the density of the stone to the density of water. Since the density of water is 1 g/cm³ or approximately 62.4 lbs/ft³, the specific gravity of the stone can be calculated as (105 lbs/0.39 ft³) / (62.4 lbs/ft³) ≈ 2.69.
3) Moving on to the second situation, we are given the weight of an irregularly shaped metal piece both in air and when completely submerged in water. The weight in air is 0.3 kN, and when submerged, it weighs 0.2325 kN.
Using the same principle as before, we calculate the weight difference between air and water to find the buoyant force acting on the metal. Dividing this weight difference by the density of water, which is approximately 1000 kg/m³, we can determine the volume of the metal. The volume is calculated as (0.3 kN - 0.2325 kN) / (1000 kg/m³) ≈ 0.017 m³.
Learn more about specific gravity
brainly.com/question/9100428
#SPJ11
Suppose an individual makes an initial investment of $2,000 in an account that earns 7.2%, compounded monthly, and makes additional contributions of $100 at the em of each month for a period of 12 years. After these 12 years, this individual wants to make withdrawals at the end of each month for the next 5 years (so that the account balance will be reduced to $0). (Round your answers to the nearest cent.) (a) How much is in the account after the last deposit is made?
(b) How much was deposited? $ x (c) What is the amount of each withdrawal? $ (d) What is the total amount withdrawn?
(a) The account balance after the last deposit is made is approximately $33,847.94.
(b) The total amount deposited over the 12-year period is approximately $17,200.
(c) The amount of each withdrawal is approximately $628.34.
(d) The total amount withdrawn over the 5-year period is approximately $37,700.
To calculate the final balance after the last deposit, we can use the formula for compound interest:
A = P(1 + r/n)^(nt)
Where:
A = the final amount
P = the principal amount (initial investment)
r = the annual interest rate (7.2% or 0.072)
n = the number of times the interest is compounded per year (12 for monthly compounding)
t = the number of years (12)
Using the given values, we can plug them into the formula:
A = 2000(1 + 0.072/12)^(12*12)
A ≈ $33,847.94
To calculate the total amount deposited, we need to consider the monthly contributions over the 12-year period:
Total contributions = (monthly contribution) × (number of months)
Total contributions = 100 × 12 × 12
Total contributions = $17,200
For the amount of each withdrawal, we need to distribute the remaining balance evenly over the 5-year period:
Amount of each withdrawal = (final balance) / (number of months)
Amount of each withdrawal = $33,847.94 / (5 × 12)
Amount of each withdrawal ≈ $628.34
Finally, to calculate the total amount withdrawn, we multiply the amount of each withdrawal by the number of months:
Total amount withdrawn = (amount of each withdrawal) × (number of months)
Total amount withdrawn = $628.34 × (5 × 12)
Total amount withdrawn ≈ $37,700
Learn more about account balance
brainly.com/question/28699225
#SPJ11
Given f(x)=(x^2+4)(x^2+8x+25) i) Find the four roots of f(x)=0. ii) Find the sum of these four roots.
(i) The four roots of [tex]`f(x) = (x^2 + 4)(x^2 + 8x + 25) = 0[/tex]` are 2i, -2i, -4 + 3i, and -4 - 3i. (ii) The sum of these four roots is -8.
Given that [tex]`f(x)=(x^2+4)(x^2+8x+25)`[/tex] we need to find the four roots of f(x)=0 and sum of these four roots.
i) To find the four roots of `f(x)=0`, first we need to find the roots of the quadratic factors:
[tex]`x^2 + 4` and `x^2 + 8x + 25`.x^2 + 4 = 0x^2 = -4x = ± sqrt(-4) = ± 2i[/tex]
So the roots of [tex]x^2 + 4[/tex] are [tex]x = 2i[/tex] and [tex]x = -2i.x^2 + 8x + 25 = 0x = (-b ± sqrt(b^2 - 4ac)) / 2a[/tex]
where a = 1, b = 8, and c = 25x = (-8 ± sqrt(8^2 - 4(1)(25))) / 2x = (-8 ± sqrt(64 - 100)) / 2x = (-8 ± sqrt(-36)) / 2x = (-8 ± 6i) / 2x = -4 ± 3i
So the roots of [tex]x^2[/tex] + 8x + 25 are x = -4 + 3i and x = -4 - 3i.
So, the four roots of [tex]`f(x) = (x^2 + 4)(x^2 + 8x + 25) = 0[/tex]` are 2i, -2i, -4 + 3i, and -4 - 3i.
ii) The sum of these four roots is: 2i + (-2i) + (-4 + 3i) + (-4 - 3i) = -8.
Therefore, the sum of these four roots is -8.
To know more about roots visit:
https://brainly.com/question/12850021
#SPJ11
Given the differential equation, (x^2+y^2)+2xydy/dx=0 a) Determine whether the differential equation is separable or homogenous. Explain. b) Based on your response to part (a), solve the given differential equation with the appropriate method. Do not leave the answer in logarithmic equation form. c) Given the differential equation above and y(1)=2, solve the initial problem.
(A) This differential equation is not separable, but it is homogeneous since the degree of both terms in the brackets is the same and equal to [tex]$2.$[/tex] (B) The solution to the given differential equation is: [tex]$$\boxed{y^2 = \frac{Cx^2}{2} - \frac{x^2}{2} \ln(1 + \frac{y^2}{x^2})}$$[/tex] where [tex]$C$[/tex] is the constant of integration. (C) The solution to the initial value problem is: [tex]$$y^2 = \frac{(2\ln(5) + 8)x^2}{2} - \frac{x^2}{2} \ln(1 + \frac{y^2}{x^2})$$[/tex]
a) To determine whether the differential equation is separable or homogenous, let us check whether the equation can be written in the form of:
[tex]$$N(y) \frac{dy}{dx} + M(x) = 0$$[/tex] or in the form of:
[tex]$$\frac{dy}{dx} = f(\frac{y}{x})$$[/tex]
For the given equation:
[tex]$$(x^2 + y^2) + 2xy \frac{dy}{dx} = 0$$[/tex]
Upon dividing both sides by:
[tex]$x^2$,$$\frac{1}{x^2}(x^2 + y^2) + 2 \frac{y}{x} \frac{dy}{dx} = 0$$or$$1 + (\frac{y}{x})^2 + 2 \frac{y}{x} \frac{dy}{dx} = 0$$[/tex]
This equation is not separable, but it is homogeneous since the degree of both terms in the brackets is the same and equal to [tex]$2.$[/tex]
b) We can solve the given differential equation using the method of substitution.
First, let [tex]$y = vx.$[/tex]
Then, [tex]$\frac{dy}{dx} = v + x \frac{dv}{dx}.$[/tex]
Substituting these values into the equation, we get:
[tex]$$x^2 + (vx)^2 + 2x(vx) \frac{dv}{dx} = 0$$$$x^2(1 + v^2) + 2x^2v \frac{dv}{dx} = 0$$$$\frac{dv}{dx} = -\frac{1}{2v} - \frac{x}{2(1 + v^2)}$$[/tex]
Now, this differential equation is separable, and we can solve it using the method of separation of variables.
[tex]$$-2v dv = \frac{x}{1 + v^2} dx$$$$-\int 2v dv = \int \frac{x}{1 + v^2} dx$$$$-v^2 = \frac{1}{2} \ln(1 + v^2) + C$$$$v^2 = \frac{C - \ln(1 + v^2)}{2}$$$$y^2 = \frac{Cx^2}{2} - \frac{x^2}{2} \ln(1 + \frac{y^2}{x^2})$$[/tex]
Therefore, the solution to the given differential equation is:
[tex]$$\boxed{y^2 = \frac{Cx^2}{2} - \frac{x^2}{2} \ln(1 + \frac{y^2}{x^2})}$$[/tex]
where [tex]$C$[/tex] is the constant of integration.
c) Given the differential equation above and [tex]$y(1) = 2,$[/tex] we can substitute [tex]$x = 1$ and $y = 2$[/tex] in the solution equation obtained in part (b) to find the constant of integration [tex]$C[/tex].
[tex]$$$y^2 = \frac{Cx^2}{2} - \frac{x^2}{2} \ln(1 + \frac{y^2}{x^2})$$$$2^2 = \frac{C \cdot 1^2}{2} - \frac{1^2}{2} \ln(1 + \frac{2^2}{1^2})$$$$4 = \frac{C}{2} - \frac{1}{2} \ln(5)$$$$C = 2\ln(5) + 8$$[/tex]
Thus, the solution to the initial value problem is: [tex]$$y^2 = \frac{(2\ln(5) + 8)x^2}{2} - \frac{x^2}{2} \ln(1 + \frac{y^2}{x^2})$$[/tex]
To know more about differential equation visit:
https://brainly.com/question/32514740
#SPJ11
Find an interval of length π that contains a root of the equation x∣cos(x)∣=1/2.
An interval of length π that contains a root of the equation x∣cos(x)∣=1/2 is [π/3 - π/2, π/3 + π/2].
To find an interval of length π that contains a root of the equation x∣cos(x)∣=1/2, we can start by graphing the function y = x∣cos(x)∣ - 1/2.
By observing the graph, we can see that the equation has multiple roots.
In order to find an interval of length π that contains a root, we need to identify one of the roots and then determine an interval around it.
One of the roots of the equation can be found by considering the value of x for which cos(x) = 1/2.
We know that cos(x) = 1/2 when x = π/3 or x = 5π/3.
Let's choose the root x = π/3.
Now, to find the interval of length π that contains this root, we need to consider values of x around π/3.
Let's choose the interval [π/3 - π/2, π/3 + π/2].
This interval is centered around π/3 and has a length of π, as required.
To confirm that this interval contains the root, we can evaluate the function at the endpoints of the interval.
Substituting x = π/3 - π/2 into the equation x∣cos(x)∣ - 1/2, we get (π/3 - π/2)∣cos(π/3 - π/2)∣ - 1/2.
Substituting x = π/3 + π/2 into the equation x∣cos(x)∣ - 1/2, we get (π/3 + π/2)∣cos(π/3 + π/2)∣ - 1/2.
By evaluating these expressions, we can determine whether they are less than, equal to, or greater than zero.
If one is less than zero and the other is greater than zero, then the root is indeed within the interval.
In this case, the interval [π/3 - π/2, π/3 + π/2] contains the root x = π/3, and its length is π.
Therefore, an interval of length π that contains a root of the equation x∣cos(x)∣=1/2 is [π/3 - π/2, π/3 + π/2].
Learn more about interval of length from this link:
https://brainly.com/question/31942533
#SPJ11
Predict the resonance stabilization of propenyl cation and radical from SHM. We expect the resonance energy to decrease as we add pi-electrons. What happens with these systems (w.r.to the stabilization energies) and what do you think is the reason for the same?
The delocalization of electrons through resonance has a profound impact on the stability of organic molecules. Resonance stabilization in organic molecules is an important aspect of organic chemistry.
The π-electrons of a molecule can be delocalized over the entire molecular structure in the presence of pi bonds. Let us discuss the resonance stabilization of propenyl cation and radical from SHM.Shimizu, Hirao, and Miyamoto (SHM) developed a new method for estimating the energy of a molecule with resonance by measuring its distortion energy. Shimizu, Hirao, and Miyamoto calculated the stabilization energy for three propenyl cations (Propene, CH2=CH-CH2+), Propenyl radicals (CH2=CH-CH2•), and Propenyl anions (CH2=CH-CH2-), with and without resonance. They found that the Propenyl cation and radical systems had very low stabilization energy compared to their non-resonance forms, while the Propenyl anion system was highly stabilized by resonance.
In the Propenyl cation and radical systems, as the number of π-electrons increases, the resonance energy decreases. When the number of π-electrons increases, the positive charge is distributed among more atoms, resulting in weaker stabilization energy due to resonance. In conclusion, the resonance energy decreases as the number of pi electrons increases for Propenyl cation and radical. The reason for this is that as the number of pi-electrons increases, the positive charge is distributed among more atoms, resulting in weaker stabilization energy due to resonance.
To know more about delocalization visit
https://brainly.com/question/31227124
#SPJ11
Example Sketch the period and find Fourier series associated with the function f(x) = x², for x € (-2,2]. TI
The Fourier series associated with the given function f(x) = x² for x € (-2,2] is given by
f(x) = 4/3 - 4/π³ ∑_n=1^∞ 1/(2n-1)³ cos [(2n-1)πx / 2].
Given function: f(x) = x² for x € (-2,2]
To sketch the period and find Fourier series associated with the given function f(x),
we need to calculate the coefficients.
The following steps will help us find the Fourier series:
The Fourier series for the given function is given bya0 = (1 / 4) ∫-2²2 x² dx
On integrating, we get
a0 = (1 / 4) [ (8 / 3) x³ ]²-² = 0a0 = 0
Next, we need to calculate the values of an and bn coefficients which are given by:
an = (1 / L) ∫-L^L f(x) cos (nπx / L) dx
where, L = 2bn = (1 / L) ∫-L^L f(x) sin (nπx / L) dx
where, L = 2
On substituting the given function, we get
an = (1 / 2) ∫-2²2 x² cos (nπx / 2) dx
On integrating by parts, we get
an = 8 / n³ π³ [ (-1)ⁿ - 1 ]
Therefore, an = (8 / n³ π³) [1 - (-1)ⁿ]
On substituting the given function, we get
bn = (1 / 2) ∫-2²2 x² sin (nπx / 2) dx
On integrating by parts, we get
bn = 16 / n⁵π⁵ [ 1 - cos(nπ) ]
On substituting n = 2m + 1, we get
bn = 0
On substituting n = 2m, we get
bn = (-1)^m (32 / n⁵ π⁵)
Therefore, the Fourier series for the given function f(x) is given by
f(x) = ∑(-∞)^∞ cn ei nπx/L
where, cn = (an - ibn) / 2
On substituting the values of an and bn, we get
f(x) = 4/3 - 4/π³ ∑_n=1^∞ 1/(2n-1)³ cos [(2n-1)πx / 2]
Therefore, The Fourier series associated with the given function f(x) = x² for x € (-2,2] is given by
f(x) = 4/3 - 4/π³ ∑_n=1^∞ 1/(2n-1)³ cos [(2n-1)πx / 2].
To know more about integrating by parts visit:
https://brainly.com/question/31040425
#SPJ11
According to drilling and completion engineering answer the following question: The well depth is 3000m with diameter 215.9mm (8-1/2in). The maximum bit weight is 150kN and the well angle is 2º. Buoyancy coefficient KB is 0.90 and safety factor is 1.30. The drill collar gravity qe is 1.53 kN/m. Please determine how much length of drill collar pipes used for the drilling.
The length of drill collar pipes used for drilling is 53.5 meters.
To determine how much length of drill collar pipes is used for the drilling, we need to calculate the weight required to overcome the buoyancy force acting on the drill collar, and then use that weight to calculate the length of the drill collar pipe used. The formula for calculating the weight required to overcome buoyancy is as follows:
W = Q × (1 + KB)
Where, W is the weight required to overcome buoyancy, Q is the weight of the drill collar, KB is the buoyancy coefficient, which is given as 0.90
Using the formula above, we can calculate the weight required to overcome buoyancy as follows:
W = qe × LDC × (1 + KB)
where, qe is the drill collar gravity, which is given as 1.53 kN/m
LDC is the length of the drill collar pipe used
We can substitute the given values and simplify as follows:
150 kN = 1.53 kN/m × LDC × (1 + 0.90)150
kN = 1.53 kN/m × LDC × 1.9LDC = 150 kN ÷ (1.53 kN/m × 1.9)
LDC = 53.5 m
Therefore, the length of drill collar pipes used for drilling is 53.5 meters.
Learn more about buoyancy visit:
brainly.com/question/30641396
#SPJ11
Multiply the polynomials.
(3x² + 3x + 5)(6x + 4)
OA. 18x³ + 30x² +42x - 20
B. 18x³ + 30x² + 42x+ 20
OC. 18x³ + 6x² + 42x+ 20
D. 18x³ + 30x² + 2x - 20
The given polynomials, we use the distributive property. Multiplying each term of the first polynomial by each term of the second, we get OA. 18x³ + 30x² + 42x + 20.
To multiply the given polynomials (3x² + 3x + 5) and (6x + 4), we can use the distributive property and multiply each term of the first polynomial by each term of the second polynomial.
(3x² + 3x + 5)(6x + 4)
Expanding the expression:
= 3x²(6x + 4) + 3x(6x + 4) + 5(6x + 4)
Using the distributive property:
= 18x³ + 12x² + 18x² + 12x + 30x + 20
Combining like terms:
= 18x³ + (12x² + 18x²) + (12x + 30x) + 20
= 18x³ + 30x² + 42x + 20
Consequently, the appropriate response is
OA. 18x³ + 30x² + 42x + 20
for such more question on polynomials
https://brainly.com/question/15702527
#SPJ8
Choose a type of corrosion that affects your life or that you feel presents a significant risk to health and safety or the environment. Provide pictures or video identifying your chosen example of corrosion Explain how that type of corrosion affects your life. Research and explain the exact electrochemical process involved in that type of corrosion In addition, include the following: Identify the electrodes and electrolyte. Show both half reactions and indicate which reaction is the oxidization half reaction and which is the reduction half reaction. Show the balanced chemical equation. Rate of corrosion: a Explain why the corrosion is occurring? b. Estimate the time it took for the object (your example) to corrode. Identity and explain two techniques that could be used to prevent the type of corrosion you have chosen. Many corrosion prevention techniques have environmental or health issues, for example, oil disposal or inhalation hazards. Identify and explain any such issues related to the above prevention methods. Explain how one of the following environmental conditions affects the rate AND extent of the type of corrosion you have chosen: a. acid rain OR b. climate change (warm vs. cold) OR C. de-icing technique (road salt vs. sand)
1. Iron rusting influences in many ways.
2. Iron rusting involves the formation of iron oxide by an electrochemical process on the surface, where iron oxidizes and oxygen reduces to form rust.
3. Anode is iron, and the cathode is oxygen,
4. The half-reactions involved in iron rusting are:
- Anodic response: Fe(s) →[tex]Fe^2+ (aq) + 2e^-[/tex]
- Cathodic reaction: [tex]O2(g) + 2H2O(l) + 4e^-[/tex]→ [tex]4OH^- (aq)[/tex]
5. The balanced chemical equation for iron rusting is:
[tex]- 4Fe(s) + 3O2(g) + 6H2O(l)[/tex] → [tex]4Fe(OH)3(s)[/tex]
[tex]- 4Fe(OH)3(s)[/tex] → [tex]2Fe2O3.H2O(s) + 4H2O(l)[/tex]
6. The corrosion of iron takes place because iron is a reactive metal, water, etc.
7. Two techniques that might be used to prevent the sort of corrosion I have selected are:- Protective coatings, Cathodic safety.
8. One environmental circumstance that affects the fee and extent of iron rusting is: Acid rain
1. Iron rusting influences my existence in lots of methods. Some of the effects are:
- It reduces the strength and durability of iron items, which includes bridges, pipes, cars, equipment, and so forth., making them liable to failure and injuries.- It reasons aesthetic damage and lack of value to iron gadgets, consisting of fixtures, sculptures, ornaments, and many others., making them look antique and ugly.- It increases the upkeep and replacement expenses of iron items, as they need to be repaired or replaced greater often because of corrosion.- It contributes to environmental pollution and waste, as rusted iron items release poisonous substances into the soil and water, and occupy landfills.2. The precise electrochemical process worried in iron rusting is as follows:
- When iron is uncovered to moist air, it forms a thin layer of iron oxide on its floor. This layer is porous and allows oxygen and water to penetrate deeper into the steel.- The iron atoms on the floor lose electrons and end up oxidized to form iron(II) ions. This is the anodic response.- The oxygen molecules within the air or water benefit electrons and grow to be decreased to shape hydroxide ions. This is the cathodic reaction.- The iron(II) ions and the hydroxide ions react to shape iron(II) hydroxide, which similarly reacts with oxygen to shape iron(III) hydroxide. This compound dehydrates and oxidizes to form iron(III) oxide-hydroxide, which is a reddish-brown substance called rust.3. The electrodes and electrolyte worried in iron rusting are:
- The anode is the iron metal itself, in which oxidation takes place.- The cathode is the oxygen molecule, wherein reduction takes place.- The electrolyte is the water or moisture that includes dissolved oxygen and other ions.4. The half-reactions involved in iron rusting are:
- Anodic response: Fe(s) →[tex]Fe^2+ (aq) + 2e^-[/tex]
- Cathodic reaction: [tex]O2(g) + 2H2O(l) + 4e^-[/tex]→ [tex]4OH^- (aq)[/tex]
5. The balanced chemical equation for iron rusting is:
[tex]- 4Fe(s) + 3O2(g) + 6H2O(l)[/tex] → [tex]4Fe(OH)3(s)[/tex]
[tex]- 4Fe(OH)3(s)[/tex] → [tex]2Fe2O3.H2O(s) + 4H2O(l)[/tex]
6. Rate of corrosion:
a. The corrosion of iron takes place because iron is a reactive metal that tends to lose electrons and form positive ions in aqueous solutions. Iron additionally has a high affinity for oxygen and paperwork stable oxides that adhere to its floor.
The presence of water or moisture facilitates the transport of electrons and ions between the anode and the cathode, as a consequence accelerating the corrosion procedure.
B. The time it took for the object (your example) to corrode depends on many elements, such as the sort, size, form, and composition of the item, the environmental situations (temperature, humidity, acidity, salinity, etc.), and the presence or absence of protective coatings or inhibitors. Therefore, it's miles difficult to estimate a genuine time for corrosion without knowing that information.
7. Two techniques that might be used to prevent the sort of corrosion I have selected are:
- Protective coatings: Applying a layer of paint, plastic, or steel on the floor iron can prevent or lessen the touch between iron and the corrosive agents (oxygen and water). This can slow down or forestall the corrosion manner. - Cathodic safety: Connecting iron to a more electropositive metal (such as zinc or magnesium) can save you or reduce the corrosion of iron.8. One environmental circumstance that affects the fee and extent of iron rusting is:
- Acid rain: Acid rain is rainwater that contains acidic pollutants together with sulfur dioxide and nitrogen oxides from commercial emissions or volcanic eruptions. Acid rain lowers the pH of the electrolyte (water or moisture) and increases its conductivity.
To know more about iron rusting,
https://brainly.com/question/30006164
#SPJ4
Calculate the solubility of CaSO3
(a) in pure water and (b) in a solution in which
[SO32-] =
0.190 M.
Solubility in pure water =
M
Solubility in 0.190 M
SO32- =
M
(a) The solubility of [tex]CaSO_3[/tex] in pure water is M.
(b) The solubility of [tex]CaSO_3[/tex] in a solution with [[tex]SO_3^2^-[/tex]] = 0.190 M is M.
When calcium sulfite ([tex]CaSO_3[/tex]) dissolves in water, it dissociates into its respective ions, calcium ions ([tex]Ca^2^+[/tex]) and sulfite ions[tex](SO_3^2^-)[/tex]. The solubility of a compound is defined as the maximum amount of the compound that can dissolve in a given amount of solvent at a particular temperature. In this case, we need to calculate the solubility of [tex]CaSO_3[/tex] in two different scenarios: pure water and a solution with a specified concentration of sulfite ions.
(a) Solubility in pure water:
In pure water, where there is no additional presence of sulfite ions, the solubility of [tex]CaSO_3[/tex] is M. This means that at equilibrium, the concentration of [tex]Ca^2^+[/tex] and [tex]SO_3^2^-[/tex] ions in the solution would be M.
(b) Solubility in a solution with [tex][SO_3^2^-][/tex] = 0.190 M:
When there is a solution with a concentration of [tex][SO_3^2^-][/tex] = 0.190 M, the equilibrium of the solubility of [tex]CaSO_3[/tex] is affected. The presence of sulfite ions in the solution creates a common ion effect, which reduces the solubility of CaSO₃. As a result, the solubility of CaSO₃ in this solution would be M. The additional concentration of sulfite ions shifts the equilibrium and decreases the amount of CaSO₃ that can dissolve in the solution.
In summary, the solubility of CaSO₃ in pure water is M, while in a solution with [SO32-] = 0.190 M, the solubility is M due to the common ion effect.
The solubility of a compound is influenced by several factors, including temperature, pressure, and the presence of other ions in the solution. In this case, the concentration of sulfite ions ([tex][SO_3^2^-][/tex]) has a significant impact on the solubility of CaSO₃. The common ion effect occurs when a compound is dissolved in a solution that already contains one of its constituent ions. The presence of the common ion reduces the solubility of the compound.
The common ion effect can be explained by Le Chatelier's principle. According to this principle, if a stress is applied to a system at equilibrium, the system will shift to counteract that stress and restore equilibrium.
In the case of CaSO₃, the addition of sulfite ions in the form of [tex][SO_3^2^-][/tex] in the solution increases the concentration of the sulfite ion. In response to this increase, the equilibrium shifts to the left, reducing the solubility of CaSO₃. This shift occurs to minimize the stress caused by the increased concentration of the common ion.
The solubility product constant (Ksp) is a useful tool to quantify the solubility of a compound. It represents the equilibrium expression for the dissociation of a sparingly soluble compound. For CaSO₃, the Ksp expression would be:
[tex]Ksp = [Ca^2^+][SO_3^2^-][/tex]
The solubility can be calculated using the Ksp expression and the concentrations of the ions at equilibrium.
Learn more about solubility
brainly.com/question/31493083
#SPJ11
1) single planer object is a command used to create a connected sequence of segments that acts as a a) Line b) Offset c) Rectangular Array d) Polyline.
The command "single planer object" is used to create a connected sequence of segments. This means that it helps you draw a continuous line or shape.
Out of the given options, the command "single planer object" is used to create a polyline. A polyline is a series of connected line segments or arcs. It is often used to create complex shapes or paths in computer-aided design (CAD) software.
Here's an example of how you can use the "single planer object" command to create a polyline:
1. Open the CAD software and select the "single planer object" command.
2. Start by clicking on a point in the workspace to begin drawing the polyline.
3. Move your cursor and click on additional points to create line segments or arcs. Each click adds a new segment to the polyline.
4. Continue adding points until you have created the desired shape or path.
5. To close the polyline, you can either click on the starting point or use a command to close it automatically.
Remember, a polyline can be edited and modified after it is created. You can add or remove segments, adjust the shape, or change its properties such as thickness or color.
In summary, the "single planer object" command is used to create a connected sequence of segments, known as a polyline. It allows you to draw complex shapes or paths in CAD software by clicking on points to create line segments or arcs.
To learn more about software
https://brainly.com/question/28224061
#SPJ11
The solution for x² + 2x + 8 ≤0 is
The empty set
2 or 4
-2 or 4
The solution to the inequality x² + 2x + 8 ≤ 0 is the empty set, which means there are no values of x that satisfy the inequality.
To solve the inequality x² + 2x + 8 ≤ 0, we can use various methods such as factoring, completing the square, or the quadratic formula.
Let's solve it by factoring:
Start with the inequality: x² + 2x + 8 ≤ 0.
Attempt to factor the quadratic expression on the left-hand side. However, in this case, the quadratic does not factor nicely using integers.
Since factoring doesn't work, we can use the quadratic formula to find the roots of the quadratic equation x² + 2x + 8 = 0.
The quadratic formula is given by: x = (-b ± √(b² - 4ac)) / (2a), where a, b, and c are the coefficients of the quadratic equation (ax² + bx + c = 0).
Plugging in the values for our equation, we get: x = (-2 ± √(2² - 418)) / (2*1).
Simplifying further, we have: x = (-2 ± √(-28)) / 2.
Since the discriminant (-28) is negative, there are no real solutions, which means the quadratic equation has no real roots.
For similar question on inequality.
https://brainly.com/question/30238989
#SPJ8
how much is 453 million?
Hello!
453 millions
= 453 000 000
Functions f(x) and g(x) are defined as follows: f(x)=2x+3(−[infinity]
The function f(x) = 2x + 3 as x approaches negative infinity tends to negative infinity.
The function f(x) = 2x + 3 can be evaluated for any value of x. However, the notation "−[infinity]" after the function definition seems to indicate that the function is defined only for values of x approaching negative infinity.
To understand the meaning of the function f(x) = 2x + 3 as x approaches negative infinity, we can consider the behavior of the function for extremely large negative values of x.
As x becomes more and more negative (approaching negative infinity), the term 2x dominates the function. Since x is negative, 2x becomes more negative as x decreases. Therefore, as x approaches negative infinity, 2x approaches negative infinity as well.
The constant term 3 remains the same regardless of the value of x. Therefore, as x approaches negative infinity, the function f(x) = 2x + 3 also approaches negative infinity.
In other words, as x becomes increasingly negative, the output values of the function f(x) become increasingly negative. The function has a negative slope and decreases without bound as x approaches negative infinity.
Learn more about function from ;
https://brainly.com/question/11624077
#SPJ11
What is the length of the indicated side of the trapezoid?
The length of the indicated side of the trapezoid is 10 inches
What is the length of the indicated side of the trapezoid? From the question, we have the following parameters that can be used in our computation:
The trapezoid
The length of the indicated side of the trapezoid is calculated as
Length² = (18 - 12)² + 8²
Evaluate the sum
So, we have
Length² = 100
Take the square root of both sides
Length = 10
Hence, the length of the indicated side of the trapezoid is 10 inches
Read more about trapezoid at
https://brainly.com/question/1463152
#SPJ1
A sample of radioactive material disintegrates from 6 to 2 grams
in 50 days. After how many days will just 1 gram remain?
It is given that a sample of radioactive material disintegrates from 6 to 2 grams in 50 days ,just 1 gram will remain after approximately 77.95 days.
We are to determine after how many days will just 1 gram remain.Let N be the number of remaining grams of the material after t days.The rate of decay of radioactive material is proportional to the mass of the radioactive material. The differential equation is given as:dN/dt = -kN,where k is the decay constant.
The solution to the differential equation is given as:[tex]N = N0 e^(-kt)[/tex]where N0 is the initial number of grams of the material and t is time in days.
If 6 grams of the material reduces to 2 grams, then N0 = 6 and N = 2.
Thus,[tex]2 = 6 e^(-k × 50) => e^(-50k) = 1/3[/tex]
On taking natural logarithm of both sides, we get:-
50k = ln(1/3) => k = (ln 3)/50
Thus, the decay equation for the material is:
[tex]N = 6 e^[-(ln 3/50) t][/tex]
At t = t1, 1 gram of the material remains.
Thus, N = 1.
Substituting this in the decay equation, we get:[tex]1 = 6 e^[-(ln 3/50) t1] => e^[-(ln 3/50) t1] = 1/6[/tex]
Taking natural logarithm of both sides, we get:-(ln 3/50) t1 = ln 6 - ln 1 => t1 = (50/ln 3) [ln 6 - ln 1] => t1 ≈ 77.95 days
Therefore, just 1 gram will remain after approximately 77.95 days.
To know more about radioactive visit:
https://brainly.com/question/1770619
#SPJ11