The correct answer To prepare a buffer solution with a pH of 8.51, we need to use the Henderson-Hasselbalch equation:
pH = pKa + log([base]/[acid] where pKa is the dissociation constant for the base, [base] is the concentration of the base, and [acid] is the concentration of the conjugate acid. For the ammonia/ammonium ion buffer system, the equation is: NH3 + H2O ⇌ NH4+ + OH- The equilibrium constant expression for this reaction is: Kb = [NH4+][OH-]/[NH3] We are given the Kb value as 1.8 x 10^-5, and we can use it to find the concentration of OH- in the buffer solution: Kb = [NH4+][OH-]/[NH3] 1.8 x 10^-5 = [NH4+][OH-]/(0.300 - [NH4+]) Let's assume that the concentration of NH4+ is much less than 0.300 M (which is a reasonable assumption for most buffer solutions). This means that we can approximate the denominator as 0.300 M: 1.8 x 10^-5 = [NH4+][OH-]/0.300 Solving for [OH-], we get: [OH-] = sqrt(Kb*[NH3]) = sqrt(1.8 x 10^-5 * 0.300) = 6.60 x 10^-4 M To find the concentration of NH4+, we can use the Henderson-Hasselbalch equation: pH = pKa + log([base]/[acid]) 8.51 = 9.25 + log([NH4+]/[NH3]) Solving for [NH4+]/[NH3], we get: [NH4+]/[NH3] = 10^(8.51-9.25) = 3.52 x 10^-2 Since we know that the total volume of the buffer solution is 2.50 L, we can use the molarity of NH3 to find the moles of NH3 in the solution: moles of NH3 = 0.300 M x 2.50 L = 0.75 mol We can then use the ratio of NH4+ to NH3 to find the moles of NH4+ in the solution: moles of NH4+ = (3.52 x 10^-2) x (0.75 mol) = 2.64 x 10^-2 mol Finally, we can use the molar mass of NH4Cl (53.49 g/mol) to find the mass of NH4Cl needed to prepare the buffer solution: mass of NH4Cl = moles of NH4Cl x molar mass of NH4Cl To find the moles of NH4Cl, we can use the stoichiometry of the reaction between NH4Cl and NH3: NH4Cl + NH3 → NH4+ + Cl- For every mole of NH4+ in the buffer solution, we need one mole NH4Cl. Therefore moles of NH4Cl = moles of NH4+ = 2.64 x 10^-2 molSubstituting this value into the equation for mass of NH4Cl, we getmass of NH4Cl = (2.64 x 10^-2 mol) x (53.49 g/mol) = 1.41 g Therefore, we need approximately 1.41 grams of dry NH4Cl to add to 2.50 L of a 0.300 M
To learn more about Henderson- click on the link below:
brainly.com/question/29619380
#SPJ1
What are the carbohydrates’ that give positive result with Seliwanoff ? why?
Answer:
Fructose and sucrose
Explanation:
Sucrose gives a positive test as it is a disaccharide consorting of fructose and glucose
Predicting Products: Mg + K2SO4. (2 and 4 are coefficients)
The reaction between magnesium (Mg) and potassium sulfate (K2SO4) is a double displacement reaction that occurs in an aqueous solution. The products that will form depend on the solubility of the resulting compounds.
When Mg and K2SO4 react, magnesium sulfate (MgSO4) and potassium (K) will be produced. This is because the magnesium will displace the potassium ion in the potassium sulfate compound, resulting in the formation of magnesium sulfate and potassium metal.
The balanced chemical equation for this reaction is:
2Mg + K2SO4 → MgSO4 + 2K
It is important to note that this reaction will only occur if the magnesium is more reactive than the potassium in the solution. If the opposite were true, no reaction would occur.
To know more about double displacement reaction , visit:
https://brainly.com/question/29307794
#SPJ1
MUST BE RIGHT AND DONE ASASP 100 POINTS
The n, l, and m1 values for the given orbitals are:
a) 4s: n=4, l=0, m1=0
b) 3d: n=3, l=2, m1=-2,-1,0,1,2
c) 5f: n=5, l=3, m1=-3,-2,-1,0,1,2,3
The element with the following valence electron configuration is:
a) 1s²: Helium (He)
b) 6s² * Δ*f¹⁴ * 5d¹ : Gold (Au)
c) 3s² * 3p⁴ : Carbon (C)
d) 4s² * 3d¹⁰ : Zinc (Zn)
The expected electron configurations for the given atoms or ions are:
a) Pb: [Xe] 6s² 4f¹⁴ 5d¹⁰ 6p²
b) Mo: [Kr] 5s¹ 4d⁵
(Note: Mo ionizes to form a cation with a +6 charge, so the expected configuration for Mo6+ would be [Kr] 4d⁰.)
The arrangement of an atom's or ion's electrons in its atomic orbitals is known as its electron configuration. The arrangement of electrons in an atom's different energy levels or shells is known as its electronic configuration.
The listing of the occupied subshells in ascending energy sequence serves as its representation.
The Aufbau principle, the Pauli exclusion principle, and Hund's rule can all be used to identify the electronic structure of an atom. According to the Aufbau principle, lower energy level orbitals fill up first, followed by higher energy level orbitals.
Each orbital can hold a maximum of two electrons due to the Pauli exclusion principle, which says that no two electrons in an atom can have the same set of four quantum numbers (n, l, m1, and ms).
learn more about electron configuration here
https://brainly.com/question/26084288
#SPJ1
In this experiment, the pH curve is obtained for titration of a weak acid with a strong base. Sketch the pH curve expected for titration of a weak base with a strong acid.
When a weak base is titrated with a strong acid, the pH curve is expected to be the inverse of the curve obtained during the titration of a weak acid with a strong base.
Initially, the solution will have a high pH, which will gradually decrease as the acid is added. As the equivalence point is approached, the pH will rapidly decrease until it reaches a minimum value. At the equivalence point, the pH will be equal to 7. After the equivalence point, the pH will gradually increase as the excess acid is titrated by the base until it reaches a final high pH value.
Therefore, the pH curve expected for titration of a weak base with a strong acid will have a shape similar to the curve obtained for titration of a weak acid with a strong base, but inverted along the y-axis.
The pH curve for titration of a weak base with a strong acid is attached below.
What is base?According to the Arrhenius concept, base is defined as a substance which yields hydroxyl ions on dissociation.These ions react with the hydrogen ions of acids to produce salt in an acid-base reaction.
Bases have a pH higher than seven as they yield hydroxyl ions on dissociation.They are soapy in touch and have a bitter taste.According to the Lowry-Bronsted concept, base is defined as a substance which accepts protons .Base react violently with acids to produce salts .Aqueous solutions of bases can be used to conduct electricity .They can also be used as indicators in acid-base titrations.
They are used in the manufacture of soaps,paper, bleaching powder.Calcium hydroxide ,a base is used to clean sulfur dioxide gas while magnesium hydroxide can be used as an antacid to cure acidity.
Learn more about base,here:
https://brainly.com/question/13773045
#SPJ2
(please verify that my answer is correct)
Elemental analysis of a pure compound indicated that the compound contained 324 g of C, 48.5 g of H and 16.0 g of O. What is its empirical formula?
C27H480
This substance's empirical formula is [tex]C_{27}H_{48}O[/tex].
The empirical formula for a compound is the simplest whole-number ratio of atoms of each element present in the compound. In this case, the compound contains 324 g of C, 48.5 g of H and 16.0 g of O. To calculate the empirical formula, we divide the mass of each element by its atomic mass. For C, divide 324 g by 12.01 g/mol, for H divide 48.5 g by 1.008 g/mol, and for O divide 16.0 g by 16.00 g/mol. Doing this gives us 27 moles of C, 48 moles of H and 1 mole of O. Since the numbers are not whole numbers, they need to be reduced to the lowest whole-number ratio. To do this, divide each number by the smallest of the three, which is 1 mole of O. This gives us 27 moles of C, 48 moles of H and 1 mole of O.Hence, this compound's empirical formula is [tex]C_{27}H_{48}O[/tex].
learn more about empirical formula Refer:brainly.com/question/14044066
#SPJ1
What is the normality of the solution that results when 4.0g of Al(NO3)3 (MW = 213.0) is dissolved in enough water to give 250mL of solution? What is the molarity of the solution?
the normality of the solution that results when 4.0g of Al(NO₃)₃ (MW = 213.0) is dissolved in enough water to give 250mL of solution the molarity of the solution is 0.0751 M.
To calculate the normality and molarity of the solution, we need to know the number of moles of Al(NO₃)₃ in the solution.
The number of moles can be calculated as:
moles = mass / molar mass
where mass is the mass of Al(NO₃)₃ and molar mass is the molecular weight of Al(NO₃)₃.
Substituting the given values, we get:
moles = 4.0 g / 213.0 g/mol = 0.01878 mol
The volume of the solution is given as 250 mL, which is equivalent to 0.25 L.
The normality of the solution is defined as the number of equivalents of solute per liter of solution. For Al(NO₃)₃, each mole of the compound produces 3 moles of ions, so the number of equivalents of Al(NO₃)₃ is:
equivalents = moles x 3
Substituting the value of moles, we get:
equivalents = 0.01878 mol x 3 = 0.05634 eq
The normality can now be calculated as:
normality = equivalents / volume
Substituting the given values, we get:
normality = 0.05634 eq / 0.25 L = 0.225 N
Therefore, the normality of the solution is 0.225 N.
The molarity of the solution is defined as the number of moles of solute per liter of solution. The number of moles of Al(NO₃)₃ in 250 mL of solution is the same as the number of moles in 1 L of solution, which is 0.01878 mol. Therefore, the molarity of the solution is:
molarity = moles / volume
Substituting the given values, we get:
molarity = 0.01878 mol / 0.25 L = 0.0751 M
Learn more about solution here:
https://brainly.com/question/30665317
#SPJ1
Use Henry's law and the solubilities given below to calculate the total volume of nitrogen and oxygen gas
that should bubble out of 1.2 L of water upon warming from 25 * C to 50°C. Assume that the water is
initially saturated with nitrogen and oxygen gas at 25 °C and a total pressure of 1.0 atm. Assume that the
gas bubbles out at a temperature of 50 °C. The solubility of oxygen gas at 50°C is 27.8 mg/L at an
oxygen pressure of 1.00 atm. The solubility of nitrogen gas at 50° C is 14.6 mg/L at a nitrogen pressure
of 1.00 atm. Assume that the air above the water contains an oxygen partial pressure of 0.21 atm and a
nitrogen partial pressure of 0.78 atm
Express your answer using two significant figures.
Answer:
1. Use Henry’s law to find the initial concentrations of oxygen and nitrogen gas in water at 25°C. Henry’s law states that the concentration of a gas in a liquid is proportional to the partial pressure of the gas above the liquid. The proportionality constant is called the Henry’s law constant and it depends on the temperature and the nature of the gas and the liquid. The formula for Henry’s law is:
C = kP
where C is the concentration of the gas in the liquid, k is the Henry’s law constant, and P is the partial pressure of the gas.
The solubilities given in the problem are actually the values of k for oxygen and nitrogen gas at 50°C. To find the values of k at 25°C, we need to use a table or a graph that shows how k changes with temperature.
Using this table, we can estimate that k for oxygen at 25°C is about 40 mg/L/atm and k for nitrogen at 25°C is about 20 mg/L/atm.
Now we can plug in the values of k and P to find C for oxygen and nitrogen at 25°C:
C_O2 = k_O2 * P_O2 = 40 mg/L/atm * 0.21 atm = 8.4 mg/L C_N2 = k_N2 * P_N2 = 20 mg/L/atm * 0.78 atm = 15.6 mg/L
2. Use the ideal gas law to find the initial moles of oxygen and nitrogen gas in water at 25°C. The ideal gas law states that the pressure, volume, temperature, and moles of a gas are related by the formula:
PV = nRT
where P is the pressure, V is the volume, n is the moles, R is the universal gas constant, and T is the temperature.
We can rearrange this formula to solve for n:
n = PV/RT
We know that P is 1 atm, V is 1.2 L, R is 0.0821 Latm/molK, and T is 298 K (25°C + 273). We can plug in these values to find n for oxygen and nitrogen:
n_O2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 298 K) = 0.049 mol n_N2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 298 K) = 0.049 mol
However, these are not the actual moles of oxygen and nitrogen gas in water, because some of them are dissolved in water. To find the moles of dissolved gas, we need to use the concentration and the volume of water:
n_dissolved_O2 = C_O2 * V = (8.4 mg/L) * (1.2 L) / (1000 mg/g) / (32 g/mol) = 0.00032 mol n_dissolved_N2 = C_N2 * V = (15.6 mg/L) * (1.2 L) / (1000 mg/g) / (28 g/mol) = 0.00067 mol
To find the moles of gas that are not dissolved, we need to subtract the moles of dissolved gas from the total moles:
n_undissolved_O2 = n_O2 - n_dissolved_O2 = 0.049 mol - 0.00032 mol = 0.049 mol n_undissolved_N2 = n_N2 - n_dissolved_N2 = 0.049 mol - 0.00067 mol = 0.048 mol
3. Use Henry’s law again to find the final concentrations of oxygen and nitrogen gas in water at 50°C. We can use the same formula as before, but with different values of k and P:
C_O2 = k_O2 * P_O2 = 27.8 mg/L/atm * 0.21 atm = 5.8 mg/L C_N2 = k_N2 * P_N2 = 14.6 mg/L/atm * 0.78 atm = 11.4 mg/L
4. Use the ideal gas law again to find the final moles of oxygen and nitrogen gas in water at 50°C. We can use the same formula as before, but with different values of V and T:
n_O2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 323 K) = 0.045 mol n_N2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 323 K) = 0.045 mol
However, these are not the actual moles of oxygen and nitrogen gas in water, because some of them are dissolved in water. To find the moles of dissolved gas, we need to use the concentration and the volume of water:
n_dissolved_O2 = C_O2 * V = (5.8 mg/L) * (1.2 L) / (1000 mg/g) / (32 g/mol) = 0.00022 mol n_dissolved_N2 = C_N2 * V = (11.4 mg/L) * (1.2 L) / (1000 mg/g) / (28 g/mol) = 0.00049 mol
To find the moles of gas that are not dissolved, we need to subtract the moles of dissolved gas from the total moles:
n_undissolved_O2 = n_O2 - n_dissolved_O2 = 0.045 mol - 0.00022 mol = 0.045 mol n_undissolved_N2 = n_N2 - n_dissolved_N2 = 0.045 mol - 0.00049 mol = 0.044 mol
5. Use the ideal gas law one more time to find the final volume of oxygen and nitrogen gas that bubbles out of water at 50°C. We can use the same formula as before, but with different values of n and P:
V_O2 = nRT/P = (0.045 mol * 0.0821 Latm/molK * 323 K) / (1 atm) = 1.20 L V_N2 = nRT/P = (0.044 mol * 0.0821 Latm/molK * 323 K) / (1 atm) = 1.17 L
6. Add the volumes of oxygen and nitrogen gas to get the total volume of gas that bubbles out of water:
V_total = V_O2 + V_N2 = 1.20 L + 1.17 L = 2.37 L
Therefore, the total volume of nitrogen and oxygen gas that should bubble out of 1.2 L of water upon warming from 25°C to 50°C is 2.4 L using two significant figures.
You are trying to increase the rate at which you can dissolve a large amount of sodium chloride into water to make a solution to use in lab.
Which of the following would be the BEST method of doing this?
A. stir and heat the mixture and use small pieces of sodium chloride
B. heat the water and use a large piece of sodium chloride
C. stir and heat the mixture and use a large piece of sodium chloride
D. heat the water and use small pieces of sodium chloride
Explain which direction the molecules will move during diffusion.
Answer: During diffusion, molecules flow down their concentration gradient.
Explanation:
They're flowing from an area of high concentration to an area of low concentration. Molecules flowing down a concentration gradient is a natural process and does not require energy.
Q. The order of acidic strength of hydrogen halides is: acid HF < HCl CH-1 > Br¹>1-1 (b) F-1 < CH-1 < Br¹ Br¹> -1 (d) F-1> CI-1 < Br¹> -1. Hint: A strong acid has a weak conjugate base and vice versa.
Answer:
im just here grabbing points dont take me as rude or anything
Explanation:
yours appreciatively bye
Consider the following intermediate chemical equations.
2 equations: first: upper C (s) plus one-half upper O subscript 2 (g) right arrow upper C upper O (g). Second: upper C upper O (g) plus one-half upper O subscript 2 (g) right arrow upper C upper O subscript 2 (g).
When you form the final chemical equation, what should you do with CO?
The CO gas produced in the first equation is used in the second equation to produce CO2 in the final equation.
In the intermediate equations, solid carbon (C) and molecular oxygen (O2) are transformed into gaseous carbon monoxide (CO), which is then reacted with more oxygen to produce carbon dioxide (CO2).
The final chemical equation can be created by combining the intermediate equations and cancelling out the intermediate reactant and product (CO and O2) to obtain the overall balanced equation for the reaction:
C(g) + O2(s) = CO2 (g)
Thus, the CO generated in the first equation is consumed in the second equation and does not show up in the third and final equation. The two intermediate reactions' combined outcome is represented by the final equation, which only includes the reactants (C and O2) and product (CO2).
Learn more about molecular oxygen here:
https://brainly.com/question/11587330
#SPJ1
Under certain conditions the decomposition of ammonia on a metal surface gives the following data.
[NH3] (M) 3.0 ✕ 10−3 6.0 ✕ 10−3 9.0 ✕ 10−3
Rate (mol/L/h) 1.5 ✕ 10−6 1.5 ✕ 10−6 1.5 ✕ 10−6
(a)
Determine the rate equation for this reaction. (Rate expressions take the general form: rate = k . [A]a . [B]b.)
(b)
Determine the rate constant (in mol/L/h) using data from the first column.
WebAssign will check your answer for the correct number of significant figures.
mol/L/h
(c)
Determine the overall order for this reaction.
The given ammonia decomposition reaction on a metal surface is zero-order with respect to ammonia. The rate constant is [tex]1.5 × 10^-6[/tex] mol/L/h and the overall reaction order is zero.
(a) Since the rate remains constant while the concentration of ammonia changes, we can conclude that the reaction is zero-order with respect to ammonia. Therefore, the rate equation is:
rate = [tex]k[NH3]^0[/tex] = k
(b) Using data from the first column, we have:
rate = [tex]k[NH3]^0[/tex]
[tex]1.5 × 10^-6 mol/L/h = k(3.0 × 10^-3 M)^0[/tex]
k =[tex]1.5 × 10^-6[/tex] mol/L/h
(c) The overall order of the reaction is the sum of the orders with respect to each reactant. Since the reaction is zero-order with respect to ammonia, the overall order is zero.
Learn more about ammonia here:
https://brainly.com/question/14672082
#SPJ1
How many moles of argon are in 35.3 g of argon?
Answer: 0.883605 or 0.884
Explanation:
The molar mass of argon is equal to the average atomic mass given in the periodic table, 39.948 g/mol.
Use the molar mass as a conversion factor between mass and moles.
35.3 g×1 mol/39.948 g=0.884 mol
What Celsius temperature, T2 , is required to change the volume of the gas sample in Part A ( T1 = 19 ∘C , V1 = 1940 L ) to a volume of 3880 L ? Assume no change in pressure or the amount of gas in the balloon. Express your answer with the appropriate units.
T2 has a temperature of 58.6 °C in Celsius.
The International System of Units (SI) has two temperature scales: the Kelvin scale and the Celsius scale.In the Celsius scale, which was formerly known as the centigrade scale outside of Sweden, the degree Celsius is the unit of measurement for temperature. The ideal gas law, which asserts that PV = nRT, describes how a gas's temperature, pressure, and volume are related to one another.
Since the pressure and amount of gas in the balloon are assumed to be constant, we can rearrange the equation to solve for the temperature:
[tex]T2 = \frac{(PV1)}{(nRV2) }[/tex]
[tex]T2 =\frac{ (1 atm)(1940 L)}{(1 mol)(8.314 J/mol .K)(3880 L) }[/tex]
T2 = 58.6 ∘C
Therefore,The Celsius temperature, T2 is 58.6°C
learn more about ideal gas law Refer:brainly.com/question/28257995
#SPJ1
It took 4.5 minutes for 1.0 L helium to effuse through a porous
barrier. How long will it take for 1.0 L Cl 2 gas to effuse under
identical conditions?
It took 19 minutes for 1.0L Cl₂ gas to effuse under identical conditions.
How to calculate the time required to effuse a gas under identical conditions?1.0 L He = 4.5 min
1.0 L Cl₂ = x min
1.0 L He = 4.5 min = 0.22[tex]\frac{L}{min}[/tex]
Now, find the rate of Cl₂ using the molar mass of Cl₂ divided by the molar mass of He: [tex]\frac{0.22}{xCl2}[/tex] = 0.52 [tex]\frac{L}{min}[/tex]
Now, we need to solve for the time Cl₂ to effuse through a porous barrier, by setting it up as a proportion;
[tex]\frac{0.52L}{1 min}[/tex] = [tex]\frac{1.0L}{x min}[/tex]
= 19 minutes.
Hence, It tooks 19 minutes for 1.0L Cl₂ gas to effuse under identical conditions.
Learn more about gas here:
https://brainly.com/question/3637358
#SPJ1
For each of the following equilibria, write the equilibrium constant expression for Kc.
1. BaSO4(s) <---->Ba2+(aq) + SO42-(aq)
2. CH3COOH (aq) + H2O (l) <--->CH3COO- (aq) + H3O+ (aq)
Equilibria are chemical reactions that happen with a change in the concentration of the reactants or products. If the forward reaction is favored, a greater concentration of the product will be formed than the reactant(s), and the reaction is said to be favored. If the reverse reaction is favored, a greater concentration of the reactant(s) will be formed and thus the reaction is said to be favored. An equilibrium constant (constant K), is a number that describes the ratio of products to reactants at an equilibrium. K is also referred to as the equilibrium coefficient.
Answer:
1. Kc = [Ba2+][SO42-]
2. Kc = [CH3COO-][H3O+]/[CH3COOH]
Explanation:
The equilibrium constant expression for Kc is the product of the concentrations of the products raised to their stoichiometric coefficients divided by the product of the concentrations of the reactants raised to their stoichiometric coefficients.
1. For the first equilibrium, BaSO4(s) <---->Ba2+(aq) + SO42-(aq), the equilibrium constant expression for Kc is: Kc = [Ba2+][SO42-].
2. For the second equilibrium, CH3COOH (aq) + H2O (l) <—>CH3COO- (aq) + H3O+ (aq), the equilibrium constant expression for Kc is: Kc = [CH3COO-][H3O+]/[CH3COOH].
Note that the concentration of water is not included in the expression because it is a pure liquid and its concentration is considered constant.
What is the pH of solution containing 2.3x10^-² mol/l of H* ions?
Answer:
4.25^²
Explanation:
pH H*is the same as 4.25^²
CAN SOMEONE HELP WITH THIS QUESTION?✨
Fe²⁺ is the reducing agent in this reaction.
In the given chemical reaction:
[tex]Cr_2O_7^{2-} + 6Fe_2+ + 14H^+ -- > 2Cr_3+ + 6Fe_3+ + 7H_2O[/tex]
We can see that Fe²⁺ is being oxidized to Fe³⁺ as it loses one electron and its oxidation state increases from +2 to +3. This means that Fe²⁺ is giving away electrons, which makes it the species that is being oxidized or the reducing agent.
Therefore, Fe²⁺ is the reducing agent in this reaction.
There are species in a chemical reaction that experience changes in their oxidation states, meaning they either acquire or lose electrons. Because it reduces another species by transferring electrons to it, the species that sheds electrons is known as the reducing agent.
The species that acquires electrons is known as the oxidizing agent because, by taking electrons from another species, it oxidizes that species.
learn more about reducing agent here
https://brainly.com/question/12549467
#SPJ1
Can you explain in detail how anion exchage occur in soil.
Answer:
With the adsorption of cations like zinc as Zn (OH)+ or ZnCl+ or both, the anion exchange is known to increase. The solid phase has an impact on the anions' concentration in the soil solution. Anions are negatively adsorbed as a result of the exchange complex's overall negative charge.
calculate the area of a book which has length 30cm and breadth 20cm
Question 1
Imagine yourself in the shoes of Dimitri Mendeleev. You are provided with two sets of cards that list properties of various
elements. These cards resemble the cards used by Mendeleev when he grouped elements. One set of cards lists the names
of known elements and their properties, while the other set of cards lists the properties of a few unknown elements. These
sets are shown below.
Known Elements Set
K
Physical State: solid
Density: 0.86 g/cm³
Conductivity: good
Physical State: solid
Density: 4.93 g/cm³
Conductivity: very poor
Solubility (H₂O): reacts rapidly Solubility (H₂O): negligible
Melting Point: 63°C
Melting Point: 113.5°C
Ge
Physical State: solid
Density: 5.32 g/cm³
Conductivity: fair
Solubility (H₂O): none
Melting Point: 937°C
CI
Ba
Physical State: solid
Density: 3.6 g/cm³
Conductivity: good
Au
Rb
Physical State: solid
Density: 19.3 g/cm³
Conductivity: excellent
Solubility (H₂O): None
Melting Point: 1064°℃
Physical State: gas
Density: 0.00178 g/cm³
Conductivity: none
Solubility (H₂O): reacts strongly Solubility (H₂O): negligible
Melting Point: 710°C
Melting Point: -189.2°C
Ag
Ar
A
The carbon cycle most affects which factor? Responses erosion erosion air quality air quality living organisms living organisms weather conditions
The carbon cycle most affects living organisms. Carbon is an essential element for life, as it is a major component of organic molecules such as carbohydrates, proteins, and fats.
The carbon cycle describes the movement of carbon between living and non-living components of the Earth's biosphere, including the atmosphere, oceans, and land. Through processes such as photosynthesis, respiration, decomposition, and combustion, carbon is exchanged between organisms and the environment, influencing the growth and survival of living organisms.
To know more about combustion please refer:
https://brainly.com/question/31123826
#SPJ1
what are minerals?
explained
A mineral is a substance such as tin, salt, or sulphur that is formed naturally in rocks and in the earth. Minerals are additionally observed in small portions in food and drink.
Why are minerals important?Minerals are integral for three essential reasons: building robust bones and teeth. controlling physique fluids inside and outdoor cells. turning the meals you devour into energy.
Why are minerals so important?Minerals are necessary for your body to remain healthy. Your physique uses minerals for many one of a kind jobs, which include maintaining your bones, muscles, heart, and talent working properly. Minerals are additionally necessary for making enzymes and hormones. There are two types of minerals: macrominerals and hint minerals.
Learn more about minerals here;
https://brainly.com/question/15844293
#SPJ1
A 0.231 M solution of acetate has a pOH of 4.90. What is the Kb of acetate?
Explanation:
o solve this problem, we need to use the relation between pOH, pH, and the dissociation constant of the conjugate base of the weak acid, which is given by:
Kb = Kw / Ka
where Kb is the dissociation constant of the conjugate base, Ka is the dissociation constant of the weak acid, and Kw is the ion product constant of water, which is 1.0 x 10^-14 at 25°C.
First, we need to find the pH of the solution, since we know the pOH:
pH + pOH = 14
pH = 14 - 4.90 = 9.10
The weak acid in this case is the acetic acid (CH3COOH), which dissociates in water according to the equation:
CH3COOH + H2O ↔ CH3COO- + H3O+
The dissociation constant of acetic acid (Ka) is 1.8 x 10^-5 at 25°C. We can use this value and the relation between Ka and Kb to find Kb:
Kb = Kw / Ka = 1.0 x 10^-14 / 1.8 x 10^-5 = 5.56 x 10^-10
Therefore, the Kb of acetate is 5.56 x 10^-10.
How many grams of hydrogen chloride can be produced from 0.490 g of hydrogen and 50.0 g chlorine? The balanced equation is:
H₂(g) + Cl₂(g) → 2 HCI(g)
Hydrogen is the limiting reactant and chlorine is in excess since there is less hydrogen chloride that can be made from it (4.56 g) than there is chlorine (51.7 g) that can. As a result, 4.56 g of hydrogen chloride can be generated.
From 0.490 g of hydrogen and 50.0 g of chlorine, how many grams of hydrogen chloride may be produced?Let's first determine how much hydrogen chloride can be made from 0.490 g of hydrogen. We'll convert from moles of hydrogen to moles of hydrogen chloride using the balanced chemical equation:
1 mole of H2 yields 2 moles of HCl.
4.56 g HCl is equal to 0.490 g H2 times (1 mole H2 / 2.016 g H2), 2 moles HCl to 1 mole H2, and 36.46 g HCl to 1 mole H2.
The result is that 4.56 g of hydrogen chloride may be made from 0.490 g of hydrogen.
Let's now determine how much hydrogen chloride 50 g of chlorine can yield:
Cl2 creates 2 moles of HCl from 1 mole.
50.0 g Cl2 multiplied by (1 mole Cl2/70.90 g Cl2), (2 moles HCl/Mole Cl2), and (36.46 g/Mole Cl2) results in 51.7 g HCl.
The result is that 50.0 g of chlorine can make 51.7 g of hydrogen chloride.
To know more about chlorine gas visit:
https://brainly.com/question/29577369
#SPJ1
A sample of helium occupies a volume of 160cm3 at 100 KPa and 25°c. what volume will it occupy if the pressure is adjusted to 80 KPa and the temperature remains unchanged?
Answer:
Explanation:Explore this page
About the gas laws calculator
This is an ideal gas law calculator which incorporates the Boyle's law , Charles's law, Avogadro's law and Gay Lussac's law into one easy to use tool you can use as a:
Boyle's Law-
[tex]\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}\\[/tex]
(Pressure is inversely proportional to the volume)
Where-
[tex]\sf V_1[/tex] = Initial volume[tex]\sf V_2[/tex] = Final volume[tex]\sf P_1[/tex] = Initial pressure[tex]\sf P_2[/tex] = Final pressureAs per question, we are given that -
[tex]\sf V_1[/tex] = 160 cm³[tex]\sf P_1[/tex] = 100KPa[tex]\sf P_2[/tex] = 80KPaNow that we have all the required values and we are asked to find out that volume which will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged. For that we can put the values and solve for the final volume of helium-
[tex]\:\:\:\:\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}[/tex]
[tex]\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf 100 \times 160 = 80 \times V_2\\[/tex]
[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf V_2 = \dfrac{100 \times 160}{80}\\[/tex]
[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf V_2 =100\times \cancel{\dfrac{ 160}{80}}\\[/tex]
[tex]\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf V_2 = 100 \times 2\\[/tex]
[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf \underline{V_2 = 200 \:cm^3 }\\[/tex]
Therefore, 200 cm³ will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged.draw and explain the energy profile diagram along with various possible conformations of cyclohexane
Answer:
we're is the diagram I don't see it
3) The volume of ammonia produced when 12g of Hydrogen combine with excess nitrogen.
Answer:
The balanced chemical reaction to form ammonia is-
N2 +3H2->2NH3
From the above reaction we can say 3 moles of hydrogen gas(h2) are required to produce 2 moles of ammonia (NH3).
To find the amount of ammonia produced when 12g of hydrogen reacts with excess nitrogen, we need to first convert the mass of hydrogen to moles using its molar mass. The molar mass of hydrogen is 1.008 g/mol, so:
12 g H2 × (1 mol H2 / 1.008 g H2) = 11.905 mol H2
Since the nitrogen is in excess, all 11.905 moles of hydrogen will react. This will produce:
2 mol NH3 / 3 mol H2 × 11.905 mol H2 = 7.937 mol NH3
Finally, we can convert the moles of ammonia to volume using the ideal gas law. Assuming standard temperature and pressure (STP) of 0°C and 1 atm, respectively, the molar volume of an ideal gas is 22.4 L/mol. Therefore:
7.937 mol NH3 × 22.4 L/mol = 177.8 L NH3
So, the volume of ammonia produced when 12g of hydrogen combines with excess nitrogen is 177.8 L.
Based on molecular orbital theory, the only molecule in the list below that has unpaired electrons is ________.
Li2
N2
C2
F2
O2
The molecule that has unpaired electrons based on molecular orbital theory is O2.
What is Electron?
An electron is a subatomic particle with a negative charge that orbits the nucleus of an atom. Electrons have a mass of approximately 9.11 x[tex]10^{-31}[/tex]kilograms and a fundamental unit of charge, which is equal to -1.602 x [tex]10^{-19}[/tex]coulombs. Electrons are involved in chemical reactions and determine the chemical and physical properties of atoms and molecules. They are also involved in the production of electricity and are the basis of modern electronics.
Molecular orbital theory is a model used to explain the bonding of molecules. According to this theory, molecular orbitals are formed by the linear combination of atomic orbitals of the constituent atoms. These molecular orbitals can be bonding or antibonding in nature, and the number of electrons in the bonding and antibonding orbitals determines the stability and reactivity of the molecule.
Learn more about Electron from the given link
https://brainly.com/question/860094
#SPJ1
Kelly wants to build a small koi fish pond in her back yard what natural material should she pine her pond with to make sure that no water leaks out the pond through gravitational water flow
Kelly should line her koi fish pond with clay to ensure that no water leaks out through gravitational water flow.
Building a koi fish pondClay is a natural material that is used widely in pond and water feature construction. It has excellent water-holding properties and is able to form a waterproof seal when properly installed. Clay liners can be formed using either bentonite clay or kaolin clay, both of which are readily available and relatively inexpensive.
When installing a clay liner, it is important to prepare the pond base by removing any sharp or protruding objects, compacting the soil, and smoothing out any irregularities. The clay liner can then be laid down in layers and compacted to ensure a uniform thickness and a solid seal.
Overall, using a clay liner is an effective way to prevent water from leaking out of a koi fish pond and to maintain a healthy environment for the fish.
More on fish ponds can be found here: https://brainly.com/question/29276248
#SPJ1