Answer:
5) 1: 63
2: 117
3: 63
4: 117
5: 63
6: 117
7: 63
8: 117
Step-by-step explanation:
Vertical, corresponding, alternate exterior, and alternate interior angles are all congruent (equal).Angles such as same side exterior and same-side interior are supplementary; meaning these angles add up to 180°.This is algebra 2, please help.
The vertex and axis of symmetry of the graph is shown in image.
What is an expression?Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.
Given that;
The function is,
⇒ f (x) = 1/4 (x + 6)² - 5
Now,
Since, The function is,
⇒ f (x) = 1/4 (x + 6)² - 5
Hence, The points corresponds to x = - 2 and - 4 are;
For x = - 2;
⇒ f (x) = 1/4 (x + 6)² - 5
⇒ f (x) = 1/4 (-2 + 6)² - 5
⇒ f (x) = 1/4 (4)² - 5
⇒ f (x) = 4 - 5
⇒ f (x) = - 1
For x = - 4;
⇒ f (x) = 1/4 (x + 6)² - 5
⇒ f (x) = 1/4 (-4 + 6)² - 5
⇒ f (x) = 1/4 (2)² - 5
⇒ f (x) = 1 - 5
⇒ f (x) = - 4
Thus, The points are;
⇒ (- 2, - 1) , (- 4, - 4)
And, The vertex of the function is,
⇒ ( - 6, - 5 )
And, The axis of symmetry of the graph is,
⇒ x = - 6
Learn more about the mathematical expression visit:
brainly.com/question/1859113
#SPJ1
whats the awnser i need help
answer:10
Step-by-step explanation:
the graph show it is 1 hour and shows 10 miles and it continues
Answer:
it should be that the miles are 10 times the amount of hours
Step-by-step explanation:
Considering that to bike 10 miles it took 1 hour and to bike 20 miles it took 2 hours it will continue going like that so the miles will always be 10 times the amount of hours
A hot air balloon is cruising at an altitude of 120 m above ground when it begins its descent the balloon descends at a rate of 4.5 m per minute explain how you would set up the equation to model when the balloon will reach an altitude of 75 m above ground then solve the equation and check your solution
The equation to model the given situation is 120 - 4.5t= 75 and the solution to the equation is 10 minutes.
What is an equation?An equation is a mathematical statement that is made up of two expressions connected by an equal sign. For example, 3x – 5 = 16 is an equation.
The balloon will reach an altitude of 75 meters above the ground.
Now, 120-75 =45 meters
Let t be the time to descends 45 meters
So, 120 - 4.5t= 75
= -4.5 t = 75-120
= -4.5t = -45
= t = -45/(-4.5)
= t = 10 minutes
Hence, the equation to model the given situation is 120 - 4.5t= 75 and the solution to the equation is 10 minutes.
Learn more about equation at:https://brainly.com/question/22688504
#SPJ1
pls help with question image is linked
The kilogram of fruits sold each day are 135 kg, 110 kg and 70 kg
How to determine the amount sold each dayFrom the question, we have the following parameters that can be used in our computation:
Day 2 = Day 1 - 25
Day 3 = 2/7 * (Day 1 + Day 2)
Total weights = 315
Next, we use the following representations
x = Day 1, y = Day 2 and z = Day 3
So, we have the following equations
y = x - 25
z = 2/7(x + y)
x + y + z = 315
Substitute y = x - 25 in z = 2/7(x + y) and x + y + z = 315
z = 2/7(x + x - 25) = 2/7(2x - 25)
x + y + z = 315 ⇒ x + x - 25 + z = 315
So, we have
z = 2/7(2x - 25)
2x + z = 340
Substitute z = 2/7(2x - 25) in 2x + z = 340
2x + 2/7(2x - 25) = 340
So, we have
7x + 2x - 25 = 1190
Evaluate the like terms
9x = 1215
Divide by 9
x = 135
So, we have
y = x - 25 = 135 - 25 = 110
z = 2/7(x + y) = 2/7 *(135 + 110) = 70
Hence, the amounts are 135 kg, 110 kg and 70 kg
Read more about equations at
https://brainly.com/question/2972832
#SPJ1
How do I do this and show work
We are given the expression:
[tex]\frac{\sqrt{2} }{3} = -\frac{2}{3} Sin\theta[/tex]
[tex]\sqrt{2}} = -2 Sin\theta[/tex] [multiplying both sides by 3]
[tex]Sin\theta = \frac{\sqrt{2}}{-2}[/tex] [Dividing both sides by -2]
[tex]Sin\theta = \frac{-1}{\sqrt{2}}[/tex]
which means:
[tex]\theta = Sin^{-1}(\frac{-1}{\sqrt{2}} )[/tex]
[tex]\theta = -Sin^{-1}(\frac{1}{\sqrt{2}} )[/tex]
θ = -45° [because [tex]Sin^{-1}(\frac{1}{\sqrt{2}})[/tex] = 45°]
Hence, the answer is -45° OR (360-45) = 315°
( NO LINKS ) How many edges does this prism have? *
A. 4
B. 8
C. 12
Answer:
C. 12
Step-by-step explanation:
At the toy store, 4 toy cars cost $3.84. How much does it cost to buy 20 toy cars?
A. $20.20
B. $17.20
C. $19.20
D. $21.20
Whoever gets the correct answer will get a crown!!!
Step-by-step explanation:
To answer this, we need to find the scale factor which is to find how much one individual car is worth.
So we need to divide 3.84 and 4.
3.84 ÷ 4 = 0.96
So each car is $0.96.
To find 20 toy cars, we need to multiply 0.96 and 20.
The answer is:
$19.20
On Melissa's 6th birthday, she gets a $2000 CD that earns 7% interest compounded quarterly. If the CD matures on her 13th birthday, how much money will be available?
Answer:
[tex]A\simeq3250.83[/tex]
Step-by-step explanation:
The amount formula in compound interest is:
[tex]A=P(1+\frac{r}{n} )^{nt}[/tex]
where:
P = principal amount
r = annual interest
n = number of compounding periods
t = number of years
We already know that:
P = $2000
[tex]r = 7\% = \frac{7\%}{100\%}=0.07[/tex]
t = 7 (number of years from 6th to 13th bday)
n = 4 (quarterly in a year)
Then,
[tex]A=2000(1+\frac{0.07}{4} )^{(4)(7)}\\\\A=2000(1+\frac{0.07}{4} )^{28}\\\\A=3250.825792\\\\A\simeq3250.83[/tex]
use substitution to solve each system of equations
2. y= 4x+5
2x+y=17
6. 3x +4y= -3
x+2y= -1
8. -1=2x - y
8x-4y=-4
10. y= -4x + 11
3x + y=9
15. -5x+4y=20
10x-8y= -40
I think it's answer this .
Help please Or else I will give You A holy SLAP
Answer:
z = 450 - 135
z + 135 = 450
Step-by-step explanation:
Han's house is 450 meters from school. Lin's house is 135 meters closer than Han's house from school. So,
450 - 135 = 315 <-- equation to look for
Lin's house is 315 meters from school.
Help me please?!!!!!!!!!
Answer:
Last option: f(x) = [tex]\sqrt[5]{\frac{x}{7} }[/tex]
Hope this helps!
Ellie ha been training for the Cedar Ridge Off-Road Race. The firt week he trained, he ran 3 day and took the ame two route each day: 2. 5 mile on a path in the wood in the morning and a longer route at the park in the afternoon. By the end of the week, Ellie had run a total of 24 mile. Which equation can you ue to find how many mile, x, Ellie ran each afternoon
The Distance that Ellie ran each evening is 16.5 miles for a entirety week.
How to find the number of miles?We can use the following equation to find how many miles, x, Ellie ran each afternoon:
x + 2.5(3) = 24
Here, x represents the number of miles Ellie ran each afternoon, 2.5 represents the number of miles she ran each morning, and 3 represents the number of days she trained. The total number of miles she ran, 24, is on the right side of the equation.
To solve for x, we can start by simplifying the left side of the equation:
x + 7.5 = 24
Then, we can subtract 7.5 from both sides:
x = 16.5
So, Ellie ran 16.5 miles each afternoon.
To know more on equation at:
brainly.com/question/2972832
#SPJ4
I need to know the steps in order to solve this math problem....Please briefly describe the steps
a) A function w(t) to represent the amount of water in the pool using the two functions is w(t) = -3t + 5.
b) The pool will leak out the water when w(t)=0.
c) It will take 1.67 hours to leak out all the water from the pool.
d) Yes, functions f(t) and d(t) will intersect on the graphs when the pool stops leaking all the water out.
e) The domain of the functions f(t), d(t) and w(t) are 0 ≤ t ≤ 1.67.
What are functions?
A relation between a collection of inputs and outputs is known as a function. A function is, to put it simply, a relationship between inputs in which each input is connected to precisely one output.
Subtract the amount flowing into the pool by the amount being drained out the pool to get the amount of water in the pool .
The given functions are -
Flowing: f(t) = t² + 8t + 9.
Draining: d(t) = t² + 11t + 4.
The amount of water in the pool is -
w(t) = f(t) - d(t)
w(t) = t² + 8t + 9 - t² - 11t - 4
w(t) = -3t + 5.
Therefore, the function obtained is w(t) = -3t + 5.
When the condition is w(t) = 0 then, the pool will have leaked all the water.
Plugging in the values -
-3t + 5 = 0.
3t = 5
t = 1.67.
Therefore, the pool will leak all the water in 1.67 hours.
Functions f(t) and d(t) intersect on the graph when all the water of the pool has been leaked. The graph is shown below.
The domain of a function is the set that contains all input values of the function. The input is the time in the given situation, so -
Time cannot be negative, hence t ≥ 0.
When all the water has been drained, everything stops, hence t ≤ 1.67.
Therefore, the domain of the function is 0 ≤ t ≤ 1.67.
To learn more about function from the given link
https://brainly.com/question/22340031
#SPJ1
How can -6 1/3 be expressed as the sum of it's integer and fractional parts?
I'm giving 20 points for this one
Answer:
bottom left: -6 + (-1/3)
Step-by-step explanation:
hope this helps :)
What is the x-coordinate of the solution to the system shown?
3x - y = 6
3x + y = 34
The x-coordinate of the solution of the system of equations is x = 20/3
What is the x-coordinate of the solution?Here we have a system of equations below:
3x - y = 6
3x + y = 34
And we want to find the x-cordinate of the solution, so we need to solve this for x.
We can use the elimination method, you can see that if we add both equations we will get:
(3x - y) + (3x + y) = 6 + 34
6x = 40
x = 40/6
We can simplify that fraction to get:
x = 20/3
That is the x-coordinate of the solution.
Learn more about systems of equations:
https://brainly.com/question/13729904
#SPJ1
upper and lower bounds question
The upper bound and lower bound of a using the equation will result to
upper bound value 136015.499
lower bound value 136014.500
How to find the upper bound and lower bound valuesEvaluating the given expression a = b + 2c
where
b = 15 to 2 significant figures
c = 68 000 to 2 significant figures
solving for a
a = b + 2c
a = 15 + 2(68000)
a = 136015
The bound values
upper bond value is the largest possible vale of a
upper bond value = 136015.499
lower bound value is the lowest possible value of a
lower bound value = 136014.500
Learn more about bound values at:
https://brainly.com/question/26155120
#SPJ1
What is the Value of P? 9=p÷9
Answer:
p = 81
Step-by-step explanation:
9 = [tex]\frac{p}{9}[/tex] Multiply both sides by 9
9(9) = [tex]\frac{p}{9}[/tex][tex](\frac{9}{1})[/tex] another name for 9 is [tex]\frac{9}{1}[/tex]
81 = p
Explain how I do this please and thank you!
Answer:
Step-by-step explanation:
You need to add both of the angles you already know (1 and 2). If you add angle 1 and angle 2 you get 74. This means m < J K M would be 74°.
Answer:
74 degrees
Step-by-step explanation:
You have to add angles 1 and 2
35 +39=74
Therefore, 74 is the answer
A DVD player had a $108. Price tags the store gave a 25% discount. What was the amount of the discount?
Answer:
$27
Step-by-step explanation:
If we know that %25 is equal to 1/4, or 0.25, then we can use an equation that look like this:
108 × 0.25 = 27
Therefore, the amount of the discount was $27
How can you solve for percentages?Solving for percentages can be tricky, and you may need help on trying to solve a problem including one. If you need to find a percentage of a number, the easiest way to do that is to convert the percentage into a fraction or decimal and multiply the total by that number.
For ex.
What is 15% of 60?
To do this, convert the percentage into a decimal.
15% converted into a decimal is 0.15.
Now multiply 60 by 0.15.
60 ÷ 0.15 = 9
So, the answer to this example would be 9.
Name the property that i hown by each equation. A. 6a 4 = 4 6a
B. 30 60 = 15(2 4)
C. 3(8x 4) = 3(4 8x)
D. 4(6a) = (4 · 6)a
A. Commutative property of addition
B. Distributive property
C. Commutative property of addition
D. Associative property of multiplication
Commutative property of addition: The commutative property of addition says that a change in the order of the numbers being added does not affect the sum. We define a commutative property of addition as adding the numbers in any order that will give the same answer.a + b =b + a
Here, a and b is whole numbers, integers or decimals, or even fractions.
Distributive property: According to this property, multiplying the summation of two or more addends by a number will give the same result as multiplying each addend individually by the number and then adding the products together. In other words, according to the distributive property, an expression of form A (B + C) can be solved as A (B+ C) = AB + AC.Associative property of multiplication: The associative property of multiplication is defined as that while multiplying three numbers, regardless of the way the numbers are grouped, the end result will always be the same.Read more about the distributive property:
https://brainly.com/question/2807928
#SPJ4
The complete question is:
Name the property that is shown by each equation.
A. 6a + 4 = 4 + 6a
B. 30 + 60 = 15(2 + 4)
C. 3(8x + 4) = 3(4 + 8x)
D. 4(6a) = (4 · 6)a
Left Riemann sum approximation Question...
The left Riemman sum approximation for f(x) = x^5, between x = 0 and x = 5, considering 5 intervals, is given as follows:
5.3248.
How to obtain the Riemman sum approximation?First we must obtain the Delta value, which is the difference between the bounds of the integral, divided by the number of integrals, thus:
[tex]\Delta_x = \frac{b - a}{n} = \frac{2 - 0}{5} = 0.4[/tex]
Then the values of x at which the numeric values are calculated are obtained as follows:
[tex]x_i = a + \Delta_x(i - 1)[/tex]
Thus the values of x are of:
[tex]x_1 = 0[/tex].[tex]x_2 = 0.4[/tex][tex]x_3 = 0.8[/tex][tex]x_4 = 1.2[/tex][tex]x_5 = 1.6[/tex]The numeric values are given as follows:
f(0) = 0^5 = 0.f(0.4) = 0.4^5 = 0.01024.f(0.8) = 0.8^5 = 0.32768.f(1.2) = 1.2^5 = 2.48832.f(1.6) = 1.6^5 = 10.48576.Then the Riemann sum approximation for the integral is given as follows:
[tex]\sum_{i = 1}^{n} \Delta_x f(x_i)[/tex]
Thus:
0.4(0 + 0.01024 + 0.32768 + 2.48832 + 10.48576) = 5.3248.
More can be learned about Riemann sum approximation at https://brainly.com/question/7229305
#SPJ1
6. 175 is ___% of 125
7. ___is 120% of 720
Answer:
6. 175/125=x/100
Cross products equal 125x=17500
Solve for x and you get 140%
7. 20% of 720 is 144. You need to find 120% so add the full 720 (100%) to the 144 and you get 864 (120%)
Step-by-step explanation:
Answer:
6. 140% 7. 864
Step-by-step explanation:
Step for #1:
1.) 175 ÷ 125 = 1.4
2.) 1.0=100 0.4=40
3.) 1.4 = 140%
Answer; 140%
Step for #2:
1.) 120% × 720 = ?
2.) 120 x 720 = 86,400
3.) 86,400 ÷ 100 = 864
Answer; 864
In the diagram below, PQ is parallel to MN. If PQ, is 22 more than MP, PO=12, and MN=12, find the length of MP. Figures are not necessarily drawn to scale. State your answer in the simplest radical form, if necessary.
The measure of the length MP is equal to 6.
What are similar triangles?Two triangles are similar triangles if they have the same corresponding angle measures and proportional side lengths.
Given is a triangle ΔOMN.
Now, ΔOMN and ΔOPQ are similar. This means that the side lengths are proportional to each other. We can write -
OP/OM = PQ/MN
12/OM = PQ/MN
12/(OP + PM) = PQ/MN
It is given that -
PQ = MP + 2
12/(OP + PM) = (MP + 2)/MN
12MN = (MP + 2)(OP + PM)
12 x 12 = (MP + 2)(MP + 12)
(MP)² + 12MP + 2MP + 24 = 144
(MP)² + 14(MP) - 120 = 0
Let MP = x, then we can write -
x² + 14x - 120 = 0
(x + 20)(x - 6) = 0
(x + 20) = 0 and (x - 6) = 0
x = - 20 and x = 6
x = 6 {Lengths cannot be negative}
Therefore, the measure of the length MP is equal to 6.
To solve more questions on similar triangles, visit the link below -
https://brainly.com/question/14926756
#SPJ1
Can some one help me with this question its hard :( down below ill give brainliest
and plz explain
x*x is x^2, because the ^2 simply means that the x is multiplying by itself
(Ex. if you had x^3, you would have x*x*x, or if you had x^4, you would have x*x*x*x and it goes the other way around as well, meaning x*x*x*x*x would be x^5)
Answer:
B. x²
Step-by-step explanation:
A number/variable multiplied by itself would be a power, in this case to the second power.
For example:
x*x*x = x³
A Chemistry book is moved 2 meters to the left and then 1 meter to the right. What is its displacement?
Answer:
1 meter to the Left
Step-by-step explanation:
Displacement is the distance between the start and ending points
By having it at first 2 meters to the left, then to move it back 1 meter to the right, you are subtracting from the initial movemnet to the left.
(2-1) = 1 meter to the Left
Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest
The value of AB= 24 BD is congruent to BC. BD=BC
BD = 5x – 26, BC = 2x + 1, and AC = 43
How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24To learn more about find value of AB refers to:
brainly.com/question/11923213
#SPJ1
Please help me on this :/
Answer
8. b
9.C
10.a
11.a
12. c
13. b
brainliest pls <3
Solve these for points I got a one in algebra so this would be helpful to my grade
The solution for each system of equations is given as follows:
1) x = -4, y = -8.
2) x = 5, y = -1.
3) x = -7, y = 2.
4) No solution.
5) x = 2, y = -6.
6) x = -3, y = 4.
How to solve the system of equations?The system of equations are solved using the elimination method, writing one variable as a function of another, replacing in the other equation, and then obtaining each variable.
For item 1, we eliminate x, as follows:
x = 12 + 2y.
Hence the solution for y is obtained as follows:
5(12 + 2y) + 3y = -44
60 + 10y + 3y = -44
13y = -104
y = -104/13
y = -8.
Then the solution for x is given as follows:
x = 12 + 2y = 12 + 2(-8) = -4.
For item 2, we have that:
y = 19 - 4x.
Hence:
7x - 2(19 - 4x) = 37
7x - 38 + 8x = 37
15x = 75
x = 5.
Hence the solution for y is of:
y = 19 - 4(5) = -1.
For item 3, we can simplify the second equation by two, hence:
-x + y = 9.
y = 9 + x.
Hence:
3x + 8(9 + x) = -5
3x + 72 + 8x = -5
11x = -77
x = -7.
Hence the solution for y is of:
y = 9 - 7 = 2.
For item 4, we have that:
x = 7 + 3y.
Hence:
2(7 + 3y) - 6y = 12
14 + 6y - 6y = 12
0y = -2. (no solution, division by zero).
For item 5, we have that:
y = -2 - 2x.
Hence:
5x + 3(-2 - 2x) = -8
5x - 6 - 6x = -8
-x = -2
x = 2.
Hence the solution for y is of:
y = -2 - 2(2)
y = -6.
For item 6, we simplify the second equation by two, hence:
2x + y = -2
y = -2 - 2x.
Replacing on the first equation, we have that:
2x + 5(-2 - 2x) = 14.
2x - 10 - 10x = 14
-8x = 24
8x = -24
x = -3.
Hence the solution for y is obtained as follows:
y = -2 - 2(-3)
y = -2 + 6
y = 4.
More can be learned about a system of equations at https://brainly.com/question/24342899
#SPJ1
HELP BRAINLIEST FOR FASTEST AND CORRECT NO NEED TO EXPLAIN
Answer:
The answer is 48
Step-by-step explanation:
Answer:
48 students
4*12=48
Find the measure of the missing angle.
Answer:
its 79 k(kkkkkkkkkkkkkkkkk
Answer:
79 i think
Step-by-step explanation: